1-Decanol → Decyl methanesulfonate

HRID 259065노트

반응식

HRID 259065 반응식
[CH2:1]([OH:11])[CH2:2][CH2:3][CH2:4][CH2:5][CH2:6][CH2:7][CH2:8][CH2:9][CH3:10].[S:12](Cl)([CH3:15])(=[O:14])=[O:13]>N1C(C)=CC(C)=CC=1C.CCCCCC>[CH3:15][S:12]([O:11][CH2:1][CH2:2][CH2:3][CH2:4][CH2:5][CH2:6][CH2:7][CH2:8][CH2:9][CH3:10])(=[O:14])=[O:13]

참가 물질

5

반응물 2

HCID 81741-DecanolHCID 31297Methanesulfonyl chloride

생성물 1

HCID 5235508Decyl methanesulfonate

시약·촉매·용매 2

HCID 79532,4,6-Trimethylpyridine용매HCID 8058Hexane용매

실험 절차

To a cooled solution of 158.3 grams of 1-decanol in 1.0 liter of collidine is added dropwise 126 grams of mesyl chloride. The resulting mixture is stirred at room temperature for 1.5 hours and then poured onto ice. The reaction mixture is extracted with ether and the ether extracts are washed with 10% hydrochloric acid. The ether extracts are combined, dried over anhydrous sodium sulfate, and the solvent removed under reduced pressure to leave an oil which solidifies upon cooling. The oil is dissolved in n-hexane and cooled to yield as crystals, decyl methylsulfonate.

후처리

  1. additionpoured onto ice
  2. extractionThe reaction mixture is extracted with ether
  3. washthe ether extracts are washed with 10% hydrochloric acid
  4. dry with materialdried over anhydrous sodium sulfate
  5. customthe solvent removed under reduced pressure
  6. customto leave an oil which
  7. temperatureupon cooling
  8. temperaturecooled

출처 및 근거

ORD 기록
ord-ecfa66b8ed5a4dfd8452d31c022d96ea
출처 데이터셋
uspto-grants-1977_07
특허 번호
US04036828

반응 노트

불러오는 중…