Neopentyl glycol → 2-((Benzyloxy)methyl)-5,5-dimethyl-1,3-dioxane

HRID 31565

반응식

HRID 31565 반응식
[CH2:1]([O:8][CH2:9][CH:10]=[O:11])[C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][CH:3]=1.[CH3:12][C:13]([CH3:18])([CH2:16]O)[CH2:14][OH:15]>O.C1(C)C=CC(S(O)(=O)=O)=CC=1.C1(C)C=CC=CC=1>[CH2:1]([O:8][CH2:9][CH:10]1[O:15][CH2:14][C:13]([CH3:18])([CH3:16])[CH2:12][O:11]1)[C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][CH:3]=1

참가 물질

5

반응물 2

HCID 31344Neopentyl glycolHCID 108989(Phenylmethoxy)acetaldehyde

생성물 1

HCID 597925572-((Benzyloxy)methyl)-5,5-dimethyl-1,3-dioxane수율 96.6%

시약·촉매·용매 2

HCID 521998p-Toluenesulfonic acid monohydrate촉매HCID 1140Toluene용매

실험 절차

To a mixture of benzyloxyacetaldehyde (5 g, 33.3 mmol), 2,2-dimethyl-1,3-propanediol (4.16 g, 40 mmol) and toluene (70 ml), p-toluenesulfonic acid monohydrate (287 mg, 1.51 mmol) was added and refluxed for 4 hours while removing water by the Dean-Stark apparatus. After the reaction mixture was cooled to room temperature, triethylamine (4 ml) was added to the reaction mixture and the solvent was removed by evaporation. The residue was purified by silica gel column chromatography (silica gel: 200 g, elution solvent: ethyl acetate/heptane=1/9) to obtain the title compound (7.6 g, yield: 96.6%) as a colorless oil.

후처리

  1. additionwas added
  2. temperaturerefluxed for 4 hours
  3. customwhile removing water by the Dean-Stark apparatus
  4. additiontriethylamine (4 ml) was added to the reaction mixture
  5. customthe solvent was removed by evaporation
  6. customThe residue was purified by silica gel column chromatography (silica gel: 200 g, elution solvent: ethyl acetate/heptane=1/9)

출처 및 근거

ORD 기록
ord-95876f928d594ffb87130057875b8aae
출처 데이터셋
uspto-grants-2008_09
특허 번호
US07425634B2

연결된 노트

불러오는 중…