Ethylene Glycol → 1,3-Dioxolane, 2-(2-bromo-5-methoxyphenyl)-

HRID 322982

반응식

HRID 322982 반응식
[Br:1][C:2]1[CH:9]=[CH:8][C:7]([O:10][CH3:11])=[CH:6][C:3]=1[CH:4]=[O:5].[CH2:12](O)[CH2:13][OH:14]>C1(C)C=CC=CC=1.C1(C)C=CC(S(O)(=O)=O)=CC=1>[Br:1][C:2]1[CH:9]=[CH:8][C:7]([O:10][CH3:11])=[CH:6][C:3]=1[CH:4]1[O:14][CH2:13][CH2:12][O:5]1

참가 물질

5

반응물 2

HCID 174Ethylene GlycolHCID 3444802-Bromo-5-methoxybenzaldehyde

생성물 1

HCID 111845031,3-Dioxolane, 2-(2-bromo-5-methoxyphenyl)-수율 95.2%

시약·촉매·용매 2

HCID 6101p-Toluenesulfonic acid촉매HCID 1140Toluene용매

실험 절차

A mixture of 2-bromo-5-methoxy-benzaldehyde (45.25 g), ethylene glycol (52.22 g) and 4-toluenesulphonic acid (0.4 g) in toluene (400 mL) is heated at reflux for 5 hours using a Dean and Stark apparatus to remove water formed in the reaction. The reaction mixture is washed five times with water (500 mL) and evaporated giving 2-(2-bromo-5-methoxyphenyl)-[1,3]dioxolane (51.9 g) as a yellow liquid.

후처리

  1. temperatureis heated
  2. temperatureat reflux for 5 hours
  3. customto remove water
  4. customformed in the reaction
  5. washThe reaction mixture is washed five times with water (500 mL)
  6. customevaporated

출처 및 근거

ORD 기록
ord-91ceb5c666b84da69273f6e9dc96427a
출처 데이터셋
uspto-grants-2001_04
특허 번호
US06211234B1

연결된 노트

불러오는 중…