Dichloromethane → 3-(2-Thienyl)-propanoic acid chloride

HRID 329389

반응식

HRID 329389 반응식
[S:1]1[CH:5]=[CH:4][CH:3]=[C:2]1[CH2:6][CH2:7][C:8]([OH:10])=O.C(Cl)[Cl:12]>C(Cl)(=O)C(Cl)=O.CN(C)C=O>[S:1]1[CH:5]=[CH:4][CH:3]=[C:2]1[CH2:6][CH2:7][C:8]([Cl:12])=[O:10]

참가 물질

5

반응물 2

HCID 6344DichloromethaneHCID 7031693-(2-Thienyl)propanoic acid

생성물 1

HCID 149601613-(2-Thienyl)-propanoic acid chloride

시약·촉매·용매 2

HCID 6228Dimethylformamide촉매HCID 65578Oxalyl chloride용매

실험 절차

To a solution of 5.0 g (0.032 mol) of 3-(2-thienyl)propionic acid in 2 ml of methylene chloride and 25 ml of oxalyl chloride was added three drops of N,N-dimethylformamide slowly. Following evolution of the gas the reaction mixture was concentrated under vacuum and 20 ml of hexane was added to the residue. The resulting mixture was filtered and the filtrate was concentrated under vacuum. The resulting compound, 3-(2-thienyl)propionyl chloride, was used directly in the following reaction.

후처리

  1. concentrationwas concentrated under vacuum and 20 ml of hexane
  2. additionwas added to the residue
  3. filtrationThe resulting mixture was filtered
  4. concentrationthe filtrate was concentrated under vacuum
  5. customThe resulting compound, 3-(2-thienyl)propionyl chloride, was used directly in the following reaction

출처 및 근거

ORD 기록
ord-2e3424e2761c4ae3b61e15296de10c0d
출처 데이터셋
uspto-grants-1990_01
특허 번호
US04891379

연결된 노트

불러오는 중…