Thionyl Chloride → HCID 19869706, 화합물

HRID 330305노트

반응식

HRID 330305 반응식
[CH2:1]([O:4][C:5]1[CH:12]=[CH:11][CH:10]=[CH:9][C:6]=1[CH2:7]O)[CH2:2][CH3:3].S(Cl)([Cl:15])=O>C1(C)C=CC=CC=1.N1C=CC=CC=1>[CH2:1]([O:4][C:5]1[CH:12]=[CH:11][CH:10]=[CH:9][C:6]=1[CH2:7][Cl:15])[CH2:2][CH3:3]

참가 물질

5

반응물 2

HCID 24386Thionyl Chloride2회HCID 12194601(2-PROPOXYPHENYL)METHANOL

생성물 1

HCID 19869706HCID 19869706, 화합물수율 104.6%

시약·촉매·용매 2

HCID 1049Pyridine촉매HCID 1140Toluene용매2회

실험 절차

A 2 liter flask was charged with 316 grams (1.9 moles, 1.0 eg.) of 2-propoxybenzyl alcohol and 15 grams of pyridine (0.0126 moles) in 750 ml of toluene. 237 grams (1.99 moles, 1.01 ec.) of thionyl chloride was slowly added dropwise, allowing the reaction mixture to reflux during the addition. The reaction was stirred 4 hours at room temperature after which the toluene and thionyl chloride were removed under reduced pressure. To the remaining oil was added water and ether and washed with saturated NaHCO3 Drying and removal of the solvent gave 367 grams (100% yield) of a red oil.

후처리

  1. temperatureto reflux during the addition
  2. customwere removed under reduced pressure
  3. additionTo the remaining oil was added water and ether
  4. washwashed with saturated NaHCO3 Drying and removal of the solvent

출처 및 근거

ORD 기록
ord-1887c46c178047f4904870d84746ad48
출처 데이터셋
uspto-grants-1990_01
특허 번호
US04895865

반응 노트

불러오는 중…