Hexane → Phenyl(5-phenyl-4,5-dihydro-1H-pyrazol-1-yl)methanone

HRID 330351노트

반응식

HRID 330351 반응식
[C:1]([NH:9][N:10]=[CH:11][CH:12]=[CH:13][C:14]1[CH:19]=[CH:18][CH:17]=[CH:16][CH:15]=1)(=[O:8])[C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][CH:3]=1.CCCCCC>C1(OC2C=CC=CC=2)C=CC=CC=1>[C:1]([N:9]1[CH:13]([C:14]2[CH:19]=[CH:18][CH:17]=[CH:16][CH:15]=2)[CH2:12][CH:11]=[N:10]1)(=[O:8])[C:2]1[CH:3]=[CH:4][CH:5]=[CH:6][CH:7]=1

참가 물질

4

반응물 2

HCID 8058HexaneHCID 346108HCID 346108, 화합물

생성물 1

HCID 3063662Phenyl(5-phenyl-4,5-dihydro-1H-pyrazol-1-yl)methanone수율 76%

시약·촉매·용매 1

HCID 7583Diphenyl Ether용매

반응 조건

온도
220 °C

실험 절차

Five grams of the cinnamaldehyde benzoylhydrazone was suspended in 20 ml of diphenyl ether, followed by stirring at 220° C. for 3 hours. After cooling, the reaction liquid was poured into 100 ml of hexane for the separation of insoluble matter. The insoluble matter was filtered off and recrystallized from a methanol-water solution. Thus there was obtained 3.8 g of 1-benzoyl-5-phenyl-2-pyrazoline (mp. 105°-106° C.) as the desired product. The yield was 76.0%.

후처리

  1. temperatureAfter cooling
  2. customthe reaction liquid
  3. filtrationThe insoluble matter was filtered off
  4. customrecrystallized from a methanol-water solution

출처 및 근거

ORD 기록
ord-ef63ee9358f844f1ae47b481596347d5
출처 데이터셋
uspto-grants-1990_01
특허 번호
US04895947

반응 노트

불러오는 중…