Diethyl (ethoxymethylene)malonate → HCID 178469604, 화합물

HRID 394501노트

반응식

HRID 394501 반응식
[NH2:1][C:2]1[CH:3]=[N:4][C:5]([O:8][CH3:9])=[CH:6][CH:7]=1.CC[O:12][CH:13]=[C:14]([C:20](OCC)=O)[C:15]([O:17][CH2:18][CH3:19])=[O:16].CCCCC>C1C=CC(C2C=CC=CC=2)=CC=1.C1C=CC(OC2C=CC=CC=2)=CC=1>[CH2:18]([O:17][C:15]([C:14]1[CH:20]=[N:1][C:2]2[C:3]([C:13]=1[OH:12])=[N:4][C:5]([O:8][CH3:9])=[CH:6][CH:7]=2)=[O:16])[CH3:19]

참가 물질

5

반응물 3

HCID 6871Diethyl (ethoxymethylene)malonateHCID 8003PentaneHCID 811216-Methoxy-3-pyridinylamine

생성물 1

HCID 178469604HCID 178469604, 화합물

시약·촉매·용매 1

HCID 246701,1'-Biphenyl, mixt. with 1,1'-oxybis(benzene)용매

실험 절차

3-Amino-6-methoxypyridine (12.41 g) and diethyl ethoxymethylene malonate (20.2 ml) in Dowtherm A (400 ml) were heated at reflux. under argon for 1 hour. The cooled reaction mixture was poured into pentane (1 litre). The precipitated solid was collected by filtration, washed with pentane and dried to afforded a solid (24.78 g, crude).

후처리

  1. temperatureat reflux
  2. customThe cooled reaction mixture
  3. filtrationThe precipitated solid was collected by filtration
  4. washwashed with pentane
  5. customdried
  6. customto afforded a solid (24.78 g, crude)

출처 및 근거

ORD 기록
ord-e9dc19007a98441aa2be62f5bc802324
출처 데이터셋
uspto-grants-2003_08
특허 번호
US06602882B1

반응 노트

불러오는 중…