Water → 3-Methyl-isonicotinic acid

HRID 399894

반응식

HRID 399894 반응식
[N:1]1[CH:6]=[CH:5][C:4]([CH3:7])=[C:3]([CH3:8])[CH:2]=1.[Se](=O)=[O:10].[OH2:12]>C1(OC2C=CC=CC=2)C=CC=CC=1>[CH3:8][C:3]1[CH:2]=[N:1][CH:6]=[CH:5][C:4]=1[C:7]([OH:10])=[O:12]

참가 물질

5

반응물 3

HCID 962WaterHCID 114173,4-DimethylpyridineHCID 24007Selenium Dioxide

생성물 1

HCID 15020033-Methyl-isonicotinic acid수율 44%

시약·촉매·용매 1

HCID 7583Diphenyl Ether용매

반응 조건

온도
185 °C

실험 절차

To a hot (155° C.) solution of 10.7 g (0.1 mol) of 3,4-lutidine in 100 mL diphenylether, was added 18 g (0.16 mol) selenium dioxide in portions. After about 20 minutes, the reaction was heated to 185° C. and allowed to react for approximately thirty minutes. After cooling, the reaction mixture was diluted with water and filtered. The filtrate was extracted with chloroform and the chloroform extracts were then concentrated under reduced pressure to provide 6.0 g of a pale brown solid.

후처리

  1. customto react for approximately thirty minutes
  2. temperatureAfter cooling
  3. filtrationfiltered
  4. extractionThe filtrate was extracted with chloroform
  5. concentrationthe chloroform extracts were then concentrated under reduced pressure

출처 및 근거

ORD 기록
ord-edda74628c784595821cf022a841c0a6
출처 데이터셋
uspto-grants-1998_10
특허 번호
US05824688

연결된 노트

불러오는 중…