Ethylene Oxide → Bis(2-hydroxyethyl) terephthalate

HRID 437325노트

반응식

HRID 437325 반응식
[C:1]([OH:12])(=[O:11])[C:2]1[CH:10]=[CH:9][C:5]([C:6]([OH:8])=[O:7])=[CH:4][CH:3]=1.[CH2:13]([CH:16]1OCC[O:17]1)CC.[CH2:21]1[O:23][CH2:22]1>C([O-])(=O)C1C=CC(C([O-])=O)=CC=1.C([N+](CC)(CC)CC)C.C([N+](CC)(CC)CC)C>[C:1]([O:12][CH2:21][CH2:22][OH:23])(=[O:11])[C:2]1[CH:10]=[CH:9][C:5]([C:6]([O:8][CH2:13][CH2:16][OH:17])=[O:7])=[CH:4][CH:3]=1

참가 물질

5

반응물 3

HCID 6354Ethylene OxideHCID 7489Terephthalic AcidHCID 1798322-Propyl-1,3-dioxolane

생성물 1

HCID 13739Bis(2-hydroxyethyl) terephthalate

시약·촉매·용매 1

HCID 19591307Tetraethyl ammonium terephthalate촉매

반응 조건

온도
155 °C

실험 절차

A 3-liter stirred autoclave is charged with 600 grams of crude terephthalic acid (3.61 moles), 1600 ml. of 2-propyldioxolane reaction medium, 0.11 mole of tetraethyl ammonium terephthalate catalyst and then purged with nitrogen. Liquid ethylene oxide (473 grams, 10.75 mole) is then pumped in and the reactor heated quickly to 155° C. by passing steam through internal coils. After about 31/2 minutes the reaction is terminated by pressuring the contents of the autoclave into a vessel where the ethylene oxide is flashed and then the unreacted terephthalic acid removed by filtration. Cooling of the filtrate to about 18° C. yields about 742 grams of crude bis(2-hydroxyethyl) terephthalate.

후처리

  1. custompurged with nitrogen
  2. customAfter about 31/2 minutes the reaction is terminated
  3. customthe unreacted terephthalic acid removed by filtration
  4. temperatureCooling of the filtrate to about 18° C.

출처 및 근거

ORD 기록
ord-c067fc6e57c74d5dab0ce9601fda0363
출처 데이터셋
uspto-grants-1977_06
특허 번호
US04031035

반응 노트

불러오는 중…