Staurosporine → Staurosporine

HRID 439024노트

반응식

HRID 439024 반응식
CC(C)Cc1cc(C=O)n[nH]1.CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4>CC(=O)O.CC(=O)O[BH-](OC(C)=O)OC(C)=O.CC(C)[O-].CC(C)[O-].CC(C)[O-].CC(C)[O-].CN1CCCC1=O.[Na+].[Ti+4]>CO[C@@H]1[C@H](N(C)Cc2cc(CC(C)C)[nH]n2)C[C@H]2O[C@]1(C)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4

참가 물질

9

반응물 2

HCID 44259StaurosporineHCID 164570765-(2-Methylpropyl)-1H-pyrazole-3-carbaldehyde

생성물 3

HCID 44259StaurosporineHCID 164570765-(2-Methylpropyl)-1H-pyrazole-3-carbaldehydeHCID 178496677HCID 178496677, 화합물

시약·촉매·용매 4

HCID 176Acetic Acid시약HCID 11026Titanium isopropoxide시약HCID 5049666Sodium triacetoxyborohydride시약HCID 13387N-methyl-2-pyrrolidone용매7회

반응 조건

온도
22 °C

후처리

  1. additionThe next morning, the Mosquito(R) was used to dilute the 100 mM reactions to 50 mM via addition of 1 uL DMSO to each reaction well, followed by dispense mixing.
  2. additionThe reactions were quenched with 1 uL saturated aqueous NaHCO3.
  3. additionThe reactions were quenched with 1 uL water.
  4. additionThe reactions were diluted to approximately 10 mM.
  5. aliquotMosquito(R) was used to transfer 1 uL of each quenched reaction from the 1,536-well reaction plate to 384-well analytical plates containing 60 uL DMSO for analysis by UPLC.
  6. additionMosquito(R) was used to transfer 1 uL of each quenched reaction from the 1,536-well reaction plate to 384-well analytical plates containing 60 uL DMSO for analysis by UPLC.

출처 및 근거

ORD 기록
ord-3a505f2a1dcd42ee9471ffa586b20186
출처 데이터셋
Cernak miniaturized reductive amination
원본 링크
출처 보기

반응 노트

불러오는 중…