(4-Bromophenyl)(4-chlorophenyl)methanone → 4-Chloro-4'-isopropylbenzophenone

HRID 446217노트

반응식

HRID 446217 반응식
Br[C:2]1[CH:7]=[CH:6][C:5]([C:8]([C:10]2[CH:15]=[CH:14][C:13]([Cl:16])=[CH:12][CH:11]=2)=[O:9])=[CH:4][CH:3]=1.[CH:17]([Mg]Cl)([CH3:19])[CH3:18]>O1CCCC1.[Ni](Cl)Cl.C1(P(C(P(C2C=CC=CC=2)C2C=CC=CC=2)(C)C)C2C=CC=CC=2)C=CC=CC=1>[Cl:16][C:13]1[CH:14]=[CH:15][C:10]([C:8]([C:5]2[CH:6]=[CH:7][C:2]([CH:17]([CH3:19])[CH3:18])=[CH:3][CH:4]=2)=[O:9])=[CH:11][CH:12]=1

참가 물질

5

반응물 2

HCID 2756868(4-Bromophenyl)(4-chlorophenyl)methanoneHCID 178418918HCID 178418918, 화합물

생성물 1

HCID 27576234-Chloro-4'-isopropylbenzophenone수율 198%

시약·촉매·용매 2

HCID 131730689HCID 131730689, 화합물촉매HCID 8028Tetrahydrofuran용매

실험 절차

(4-bromophenyl)(4-chlorophenyl)methanone (10.0 g, 12.3 mmol) and bis(diphenylphosphino)propane nickel(II) chloride (0.4 g, 0.7 mmol) were dissolved in purified tetrahydrofuran (200 mL) under a nitrogen atmosphere, and isopropyl magnesium chloride (18.7 mL, 37.4 mmol) was slowly added thereto at 0° C. The reaction mixture solution was stirred at room temperature for 24 hours. The reaction mixture solution was subjected to extraction with dichloromethane and distilled water, and the extracted material was subjected to column chromatography (hexane:ethylacetate=8:2). The reaction solvent was removed, and then the residue material was dried in vacuum to thereby obtain a white solid (6.3 g, yield: 72%).

후처리

  1. customat 0° C
  2. extractionThe reaction mixture solution was subjected to extraction with dichloromethane
  3. distillationdistilled water
  4. customThe reaction solvent was removed
  5. customthe residue material was dried in vacuum

출처 및 근거

ORD 기록
ord-a921723b4f7c4fc99175605abb39d337
출처 데이터셋
uspto-grants-2013_07
특허 번호
US08476474B2

반응 노트

불러오는 중…