Ammonia → N2-Methyl-5-(trifluoromethyl)pyridine-2,3-diamine

HRID 533657노트

반응식

HRID 533657 반응식
[CH3:1][NH:2][C:3]1[C:8](Br)=[CH:7][C:6]([C:10]([F:13])([F:12])[F:11])=[CH:5][N:4]=1.C(CC(=O)C)(=O)C.C(=O)([O-])[O-].[Cs+].[Cs+].[NH3:27].[Cl-].[NH4+]>C(CC(=O)C)(=O)C.[Cu+2].CN1C(=O)CCC1>[CH3:1][NH:2][C:3]1[C:8]([NH2:27])=[CH:7][C:6]([C:10]([F:13])([F:12])[F:11])=[CH:5][N:4]=1

참가 물질

8

반응물 5

HCID 222AmmoniaHCID 10796Cesium carbonateHCID 25517Ammonium ChlorideHCID 31261AcetylacetoneHCID 679813233-bromo-N-methyl-5-(trifluoromethyl)pyridin-2-amine

생성물 1

HCID 2735930N2-Methyl-5-(trifluoromethyl)pyridine-2,3-diamine

시약·촉매·용매 2

HCID 21863952acetylacetone copper(II)촉매HCID 13387N-methyl-2-pyrrolidone용매

반응 조건

온도
120 °C

실험 절차

To a pressure-resistant reaction container, N-methyl-(3-bromo-5-trifluoromethyl-pyridin-2-yl)-amine (0.51 g), copper (II) acetylacetone (0.11 g), acetylacetone (0.20 g), cesium carbonate (1.30 g), NMP (2 ml), and 28% of aqueous ammonia (1 ml) were added, and stirred at 120° C. for 7 hours, then at 130° C. for 3 hours. The mixture was allowed to cool to room temperature, and then saturated aqueous ammonium chloride solution was poured, and extracted with ethyl acetate. The organic layer was dried over sodium sulfate, and concentrated under reduced pressure. The resulting residue was subjected to silica gel column chromatography to give 0.28 g of N2-methyl-5-trifluoromethylpyridin-2,3-diamin.

후처리

  1. waitat 130° C. for 3 hours
  2. temperatureto cool to room temperature
  3. extractionextracted with ethyl acetate
  4. dry with materialThe organic layer was dried over sodium sulfate
  5. concentrationconcentrated under reduced pressure

출처 및 근거

ORD 기록
ord-73a9e64a3bdb4b72b34675b0f3862fdb
출처 데이터셋
uspto-grants-2014_10
특허 번호
US08853238B2

반응 노트

불러오는 중…