2,6-Difluorobenzoyl chloride → 2-(2,6-Difluoro-phenyl)-6,7-difluoro-benzo[d][1,3]oxazin-4-one

HRID 567683

반응식

HRID 567683 반응식
[NH2:1][C:2]1[CH:10]=[C:9]([F:11])[C:8]([F:12])=[CH:7][C:3]=1[C:4]([OH:6])=[O:5].[F:13][C:14]1[CH:22]=[CH:21][CH:20]=[C:19]([F:23])[C:15]=1[C:16](Cl)=O.C(NC1C=CC2N=C(C3C(F)=CC=CC=3F)OC(=O)C=2C=1)(=O)C>C(N(CC)CC)C.C1(C)C=CC=CC=1>[F:13][C:14]1[CH:22]=[CH:21][CH:20]=[C:19]([F:23])[C:15]=1[C:16]1[O:5][C:4](=[O:6])[C:3]2[CH:7]=[C:8]([F:12])[C:9]([F:11])=[CH:10][C:2]=2[N:1]=1

참가 물질

5

반응물 3

HCID 874382,6-Difluorobenzoyl chlorideHCID 7359652-Amino-4,5-difluorobenzoic acidHCID 99488136-Acetamido-(2,6-difluoro-phenyl)-benzo[d][1,3]oxazin-4-one

생성물 1

HCID 98609312-(2,6-Difluoro-phenyl)-6,7-difluoro-benzo[d][1,3]oxazin-4-one

시약·촉매·용매 1

HCID 22504574Toluene triethylamine용매

실험 절차

2-Amino-4,5-difluorobenzoic acid (0.5 g), 2,6-difluorobenzoyl chloride (0.80 mL) and triethyl amine/toluene (1/1) (18 mL) were reacted as described under (10). Reaction time 1 day. Extraction between ethyl acetate (20 mL) and HCl (2N,20 mL), followed by separation of the organic toluene and precipitated with hexane. The resulting mixture was further purified on a silicagel column using dichloromethane as eluent. The isolated fraction identified as 2-(2,6-difluoro-phenyl)-6,7-difluoro-benzo[d][1,3]oxazin-4-one (0.71 g), mp. 165 C, MS m/e: 295 M+.

후처리

  1. customReaction time 1 day
  2. extractionExtraction between ethyl acetate (20 mL) and HCl (2N,20 mL)
  3. customfollowed by separation of the organic toluene
  4. customprecipitated with hexane
  5. customThe resulting mixture was further purified on a silicagel column

출처 및 근거

ORD 기록
ord-a2fa7b48033c463e94febb15bcd28172
출처 데이터셋
uspto-grants-2001_01
특허 번호
US06180625B2

연결된 노트

불러오는 중…