Pyridine → HCID 86754274, 화합물

HRID 582728노트

반응식

HRID 582728 반응식
[CH3:1][C:2]1[CH2:3][CH:4]([OH:8])[CH2:5][C:6]=1[CH3:7].N1C=CC=CC=1.[Cl:15]/[C:16](/[C:26]([F:29])([F:28])[F:27])=[CH:17]\[C@@H:18]1[C@H:20]([C:21](Cl)=[O:22])[C:19]1([CH3:25])[CH3:24]>C(C1C=C(C)C=C(C(C)(C)C)C=1O)(C)(C)C.C1(C)C=CC=CC=1>[Cl:15]/[C:16](/[C:26]([F:27])([F:28])[F:29])=[CH:17]\[C@@H:18]1[C@H:20]([C:21]([O:8][CH:4]2[CH2:5][C:6]([CH3:7])=[C:2]([CH3:1])[CH2:3]2)=[O:22])[C:19]1([CH3:25])[CH3:24]

참가 물질

6

반응물 3

HCID 1049PyridineHCID 11334477(1RS)-cis-3-(Z-2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarbonyl chlorideHCID 135076013,4-Dimethyl-3-cyclopenten-1-ol

생성물 1

HCID 86754274HCID 86754274, 화합물수율 86.5%

시약·촉매·용매 2

HCID 314042,6-Di-tert-butyl-4-methylphenol촉매HCID 1140Toluene용매

실험 절차

To a mixture of 3,4-dimethyl-3-cyclopenten-1-ol (175 mg), 2,6-di-tert-butyl-4-methylphenol (5 mg), pyridine (150 mg) and toluene (10 ml), (1RS)-cis-3-(Z-2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarbonyl chloride (395 mg) was added under ice-cooling. The resulting reaction mixture was further allowed to react for 8 hours at room temperature. Then the reaction mixture was subjected to the same post-treatment as in Example 1 to afford 441 mg of 3,4-dimethyl-3-cyclopenten-1-yl (1RS)-cis-3-(Z-2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylate (Compound No. 3). Yield 84% nD25 1.4620

후처리

  1. additionwas added under ice-
  2. temperaturecooling
  3. customThe resulting reaction mixture
  4. customto react for 8 hours at room temperature

출처 및 근거

ORD 기록
ord-73b0a9d04d20408c8b1369f82b31868d
출처 데이터셋
uspto-grants-1999_07
특허 번호
US05925676

반응 노트

불러오는 중…