2-Heptanol → Cyclopropanecarboxylic acid 1-methyl-hexyl ester

HRID 61340

반응식

HRID 61340 반응식
[CH3:1][CH:2]([OH:8])[CH2:3][CH2:4][CH2:5][CH2:6][CH3:7].[CH:9]1([C:12](O)=[O:13])[CH2:11][CH2:10]1>C1(C)C=CC(S(O)(=O)=O)=CC=1.C1(C)C=CC=CC=1>[CH3:1][CH:2]([O:8][C:12]([CH:9]1[CH2:11][CH2:10]1)=[O:13])[CH2:3][CH2:4][CH2:5][CH2:6][CH3:7]

참가 물질

5

반응물 2

HCID 109762-HeptanolHCID 15655Cyclopropanecarboxylic acid

생성물 1

HCID 89705028Cyclopropanecarboxylic acid 1-methyl-hexyl ester수율 79.8%

시약·촉매·용매 2

HCID 6101p-Toluenesulfonic acid촉매HCID 1140Toluene용매

실험 절차

2-Heptanol (200 g, 1.72 mol) and cyclopropanecarboxylic acid (163 g, 1.90 mol) were added into toluene (500 mL), followed by p-toluenesulfonic acid (3.2 g, 0.0172 mol). The reaction mixture was heated to reflux for 6 hours, cooled to room temperature, and quenched with aqueous sodium bicarbonate (1 L). The reaction mixture was then washed with brine (0.5 L) and dried over sodium sulfate (50 g). The solvent was removed and the reaction mixture was distilled to provide the product cyclopropanecarboxylic acid 1-methyl-hexyl ester (253 g).

후처리

  1. temperatureThe reaction mixture was heated
  2. temperatureto reflux for 6 hours
  3. customquenched with aqueous sodium bicarbonate (1 L)
  4. washThe reaction mixture was then washed with brine (0.5 L)
  5. dry with materialdried over sodium sulfate (50 g)
  6. customThe solvent was removed
  7. distillationthe reaction mixture was distilled

출처 및 근거

ORD 기록
ord-59cafe26ff9e483eae52495a7a1c2ddb
출처 데이터셋
uspto-grants-2016_09
특허 번호
US09441185B2

연결된 노트

불러오는 중…