Water → 4-Benzyloxyphenylacetonitrile

HRID 648383

반응식

HRID 648383 반응식
O.[C-:2]#[N:3].[Na+].[CH2:5]([O:12][C:13]1[CH:20]=[CH:19][C:16]([CH2:17]Cl)=[CH:15][CH:14]=1)[C:6]1[CH:11]=[CH:10][CH:9]=[CH:8][CH:7]=1>[Cl-].C([N+](CC)(CC)CC1C=CC=CC=1)C.C1C=CC=CC=1>[CH2:5]([O:12][C:13]1[CH:20]=[CH:19][C:16]([CH2:17][C:2]#[N:3])=[CH:15][CH:14]=1)[C:6]1[CH:11]=[CH:10][CH:9]=[CH:8][CH:7]=1

참가 물질

6

반응물 3

HCID 962WaterHCID 8929Sodium CyanideHCID 700424-Benzyloxybenzyl chloride

생성물 1

HCID 5228044-Benzyloxyphenylacetonitrile수율 95.7%

시약·촉매·용매 2

HCID 66133Benzyl triethylammonium chloride촉매HCID 241Benzene용매

실험 절차

In a 100 ml four-necked flask, there were placed 3.2 g of water, 1.23 g (0.025 mole) of sodium cyanide and 0.16 g of triethylbenzylammonium chloride, and a solution prepared by dissolving 5.3 g (0.023 mole) of 4-benzyloxybenzyl chloride in 6 g of benzene was further added thereto under stirring. Then, the resultant mixture was heated at a temperature of 80° C. for 5 hours under stirring to permit a reaction. After completion of the reaction, the formed organic layer is washed with water and dried over anhydrous sodium sulfate, followed by distilling off benzene to obtain 4.83 g (0.022 mole) of 4-benzyloxyphenylacetonitrile.

후처리

  1. customIn a 100 ml four-necked flask, there were placed
  2. additionwas further added
  3. stirringunder stirring
  4. customa reaction
  5. customAfter completion of the reaction
  6. washthe formed organic layer is washed with water
  7. dry with materialdried over anhydrous sodium sulfate
  8. distillationby distilling off benzene

출처 및 근거

ORD 기록
ord-bc8b17a29a6a467894d09da987b7a9d3
출처 데이터셋
uspto-grants-1983_10
특허 번호
US04412082

연결된 노트

불러오는 중…