Diethyl (ethoxymethylene)malonate → HCID 178469604, 화합물

HRID 842031노트

반응식

HRID 842031 반응식
[NH2:1][C:2]1[CH:3]=[N:4][C:5]([O:8][CH3:9])=[CH:6][CH:7]=1.CC[O:12][CH:13]=[C:14]([C:20](OCC)=O)[C:15]([O:17][CH2:18][CH3:19])=[O:16]>C1C=CC(C2C=CC=CC=2)=CC=1.C1C=CC(OC2C=CC=CC=2)=CC=1>[CH2:18]([O:17][C:15]([C:14]1[CH:20]=[N:1][C:2]2[C:3]([C:13]=1[OH:12])=[N:4][C:5]([O:8][CH3:9])=[CH:6][CH:7]=2)=[O:16])[CH3:19]

참가 물질

4

반응물 2

HCID 6871Diethyl (ethoxymethylene)malonateHCID 811216-Methoxy-3-pyridinylamine

생성물 1

HCID 178469604HCID 178469604, 화합물

시약·촉매·용매 1

HCID 246701,1'-Biphenyl, mixt. with 1,1'-oxybis(benzene)용매

실험 절차

3-Amino-6-methoxypyridine (12.41 g) and diethyl ethoxymethylene malonate (20.2 ml) in Dowtherm A (400 ml) was heated at reflux, under argon for 1 h. The cooled reaction mixture was poured onto pentane (1 litre). The precipiated solid was collected by filration, washing with pentane. Drying afforded the title compound (24.78 g, crude).

후처리

  1. temperatureat reflux, under argon for 1 h
  2. customThe cooled reaction mixture
  3. additionwas poured onto pentane (1 litre)
  4. customThe precipiated solid was collected by filration
  5. washwashing with pentane
  6. customDrying

출처 및 근거

ORD 기록
ord-27a56546be5447379649e7eaa7c418c0
출처 데이터셋
uspto-grants-2002_04
특허 번호
US06372757B1

반응 노트

불러오는 중…