2-Bromo-3-fluoro-5-(4-octyloxyphenyl)pyrazine → 2-Fluoro-3-octyl-6-(4-octyloxyphenyl)pyrazine

HRID 864266

반응식

HRID 864266 반응식
[CH2:1]([Mg]Br)[CH2:2][CH2:3][CH2:4][CH2:5][CH2:6][CH2:7][CH3:8].Br[C:12]1[C:17]([F:18])=[N:16][C:15]([C:19]2[CH:24]=[CH:23][C:22]([O:25][CH2:26][CH2:27][CH2:28][CH2:29][CH2:30][CH2:31][CH2:32][CH3:33])=[CH:21][CH:20]=2)=[CH:14][N:13]=1>O1CCCC1.Cl[Ni]1(Cl)[P](C2C=CC=CC=2)(C2C=CC=CC=2)CCC[P]1(C1C=CC=CC=1)C1C=CC=CC=1>[F:18][C:17]1[C:12]([CH2:1][CH2:2][CH2:3][CH2:4][CH2:5][CH2:6][CH2:7][CH3:8])=[N:13][CH:14]=[C:15]([C:19]2[CH:24]=[CH:23][C:22]([O:25][CH2:26][CH2:27][CH2:28][CH2:29][CH2:30][CH2:31][CH2:32][CH3:33])=[CH:21][CH:20]=2)[N:16]=1

참가 물질

5

반응물 2

HCID 218046332-Bromo-3-fluoro-5-(4-octyloxyphenyl)pyrazineHCID 178443577HCID 178443577, 화합물

생성물 1

HCID 194182962-Fluoro-3-octyl-6-(4-octyloxyphenyl)pyrazine

시약·촉매·용매 2

HCID 178418745HCID 178418745, 화합물촉매HCID 8028Tetrahydrofuran용매2회

실험 절차

7.95 mmol of freshly prepared octylmagnesium bromide in 30 ml of tetrahydrofuran are added dropwise at -10° C. to 2.00 g (5.3 mmol) of 2-bromo-3-fluoro-5-(4-octyloxyphenyl)pyrazine and 0.03 g (0.06 mmol) of [1,3-bis-(diphenylphosphino)propane]nickel(II) chloride in 30 ml of tetrahydrofuran, and the reaction mixture is stirred overnight, during which it warms to room temperature. The reaction mixture is partitioned between aqueous ammonium chloride solution and ether, the organic phase is washed with aqueous sodium chloride solution, dried over sodium sulfate, filtered and freed from the solvent, and the mixture is purified by chromatography (silica gel/dichloromethane: hexane = 7:3). 1.12 g of 2-fluoro-3-octyl-6-(4-octyloxyphenyl)pyrazine are obtained. ##STR17## The compound has the following phase sequence:

후처리

  1. customwarms to room temperature
  2. customThe reaction mixture is partitioned between aqueous ammonium chloride solution and ether
  3. washthe organic phase is washed with aqueous sodium chloride solution
  4. dry with materialdried over sodium sulfate
  5. filtrationfiltered
  6. customthe mixture is purified by chromatography (silica gel/dichloromethane: hexane = 7:3)

출처 및 근거

ORD 기록
ord-acb452673ccb482b9d8959684f9ae9c6
출처 데이터셋
uspto-grants-1996_10
특허 번호
US05562859

연결된 노트

불러오는 중…