7-Methoxy-3,4-dihydronaphthalene-1-carbonitrile → 7-Methoxynaphthalene-1-carbonitrile

HRID 895223노트

반응식

HRID 895223 반응식
[CH3:1][O:2][C:3]1[CH:12]=[C:11]2[C:6]([CH2:7][CH2:8][CH:9]=[C:10]2[C:13]#[N:14])=[CH:5][CH:4]=1>CC1C=CC(C(C)C)=CC=1.CCCCCC.[Pd]>[CH3:1][O:2][C:3]1[CH:12]=[C:11]2[C:6]([CH:7]=[CH:8][CH:9]=[C:10]2[C:13]#[N:14])=[CH:5][CH:4]=1

참가 물질

5

반응물 1

HCID 115212017-Methoxy-3,4-dihydronaphthalene-1-carbonitrile

생성물 1

HCID 113443927-Methoxynaphthalene-1-carbonitrile수율 44.2%

시약·촉매·용매 3

HCID 23938Palladium촉매HCID 7463P-Cymene용매HCID 8058Hexane용매

반응 조건

온도
150 °C

실험 절차

To a mixture of 7-methoxy-3,4-dihydronaphthalene-1-carbonitrile (9.95 g, 53.1 mmol) in p-cymene (100 mLs) was added 10% Pd/C (5 g), the reaction mixture was stirred and heated to 150° C. overnight. The mixture was cooled and the catalyst removed by filtering through filter aid. The p-cymene was removed on the rotovap with the vacuum pump, giving a liquid which solidified on standing. The solid was slurried in hexane, filtered and dried to afford a white solid (4.3 g, 44%). A portion was purified further by silica gel (10% ethyl acetate-hexanes) to produce a white solid: mp 77-78° C.;

후처리

  1. temperatureThe mixture was cooled
  2. customthe catalyst removed
  3. filtrationby filtering
  4. filtrationthrough filter aid
  5. customThe p-cymene was removed on the rotovap with the vacuum pump
  6. customgiving a liquid which
  7. filtrationfiltered
  8. customdried

출처 및 근거

ORD 기록
ord-d76d34bc32c142899ad5f7c9c83ead79
출처 데이터셋
uspto-grants-2005_07
특허 번호
US06914074B2

반응 노트

불러오는 중…