Chloranil → HCID 86689403, 화합물

HRID 926662

반응식

HRID 926662 반응식
BrC1C=CC(C(O)C(O)=O)=CC=1.C(C1C=C(O)C(CCCCCCCC)=CC=1O)CCCCCCC.[Br:37][C:38]1[CH:43]=[CH:42][C:41]([CH:44]2[C:48](=[O:49])[O:47][C:46]3=[C:50]([CH2:73][CH2:74][CH2:75][CH2:76][CH2:77][CH2:78][CH2:79][CH3:80])[C:51]4[CH:55]([C:56]5[CH:61]=[CH:60][C:59]([Br:62])=[CH:58][CH:57]=5)[C:54](=[O:63])[O:53][C:52]=4[C:64]([CH2:65][CH2:66][CH2:67][CH2:68][CH2:69][CH2:70][CH2:71][CH3:72])=[C:45]23)=[CH:40][CH:39]=1.C1(Cl)C(=O)C(Cl)=C(Cl)C(=O)C=1Cl>ClC1C=CC=C(Cl)C=1Cl.C(O)(=O)C>[Br:62][C:59]1[CH:58]=[CH:57][C:56]([C:55]2[C:54](=[O:63])[O:53][C:52]3=[C:64]([CH2:65][CH2:66][CH2:67][CH2:68][CH2:69][CH2:70][CH2:71][CH3:72])[C:45]4[C:46](=[C:50]([CH2:73][CH2:74][CH2:75][CH2:76][CH2:77][CH2:78][CH2:79][CH3:80])[C:51]=23)[O:47][C:48](=[O:49])[C:44]=4[C:41]2[CH:42]=[CH:43][C:38]([Br:37])=[CH:39][CH:40]=2)=[CH:61][CH:60]=1

참가 물질

7

반응물 4

HCID 8371ChloranilHCID 827231,4-Benzenediol, 2,5-dioctyl-HCID 97930p-Bromomandelic acidHCID 66654027HCID 66654027, 화합물

생성물 1

HCID 86689403HCID 86689403, 화합물수율 9%

시약·촉매·용매 2

HCID 176Acetic Acid용매HCID 68951,2,3-Trichlorobenzene용매

반응 조건

온도
200 °C

실험 절차

In a 100 cm3 flask fitted with a condenser and a reverse Dean-Stark apparatus, (4-bromo-phenyl)-hydroxy-acetic acid (6.043 g, 26.16 mmol) and 2,5-dioctyl-benzene-1,4-diol (Bao, Z.; Chan, W. K.; Yu, L. J. Am. Chem. Soc. 1995, 117, 12426-12435.) (3.500 g, 10.46 mmol) are dissolved in 1,2-dichlorochlorobenzene (35 cm3). The reaction mixture is heated to 200° C. and the generated water is distilled off the using a reverse Dean-Stark apparatus. After 2 hours stirring, the reaction mixture is cooled down and the solvent was removed in vacuo. (9.501 g, Crude yield: 125%). The crude 3,7-bis-(4-bromo-phenyl)-4,8-dioctyl-3,7-dihydro-benzo[1,2-b;4,5-b′]difuran-2,6-dione (7.500 g, 10.35 mmol) is dissolved into acetic acid (125 cm3) at 50° C. before adding chloranil (5.090 g, 20.70 mmol). After 16 hours stirring, the reaction mixture is cooled down and the resulting precipitate is filtered. The recovered solid is purified by column chromatography (95:5, petroleum ether (40-60):Ethyl acetate as eluant) to obtain a crystalline orange solid (0.642 g, Yield: 9%). NMR (1H, 300 MHz, CDCl3): δ 7.63 (d, J=8.5 Hz, 4H); 7.30 (d, J=8.5 Hz, 4H); 2.46 (m, 4H); 1.19 (m, 16H); 0.98 (m, 8H); 0.88 (t, J=7.1 Hz, 6H)

후처리

  1. customIn a 100 cm3 flask fitted with a condenser
  2. distillationthe generated water is distilled off the using a reverse Dean-Stark apparatus
  3. temperaturethe reaction mixture is cooled down
  4. customthe solvent was removed in vacuo
  5. stirringAfter 16 hours stirring
  6. temperaturethe reaction mixture is cooled down
  7. filtrationthe resulting precipitate is filtered
  8. customThe recovered solid is purified by column chromatography (95:5, petroleum ether (40-60):Ethyl acetate as eluant)

출처 및 근거

ORD 기록
ord-bf8b9990784941b4812abade30b76aa5
출처 데이터셋
uspto-grants-2016_03
특허 번호
US09287504B2

연결된 노트

불러오는 중…