Potassium Cyanide → 4-Biphenylacetonitrile

HRID 964596

반응식

HRID 964596 반응식
[C-:1]#[N:2].[K+].Cl[CH2:5][C:6]1[CH:11]=[CH:10][C:9]([C:12]2[CH:17]=[CH:16][CH:15]=[CH:14][CH:13]=2)=[CH:8][CH:7]=1>S([O-])(O)(=O)=O.C([N+](CCCC)(CCCC)CCCC)CCC.ClCCl>[C:1]([CH2:5][C:6]1[CH:11]=[CH:10][C:9]([C:12]2[CH:17]=[CH:16][CH:15]=[CH:14][CH:13]=2)=[CH:8][CH:7]=1)#[N:2]

참가 물질

5

반응물 2

HCID 9032Potassium CyanideHCID 154634-Phenylbenzyl chloride

생성물 1

HCID 358564-Biphenylacetonitrile수율 67.5%

시약·촉매·용매 2

HCID 94433Tetrabutylammonium hydrogen sulfate촉매HCID 6344Dichloromethane용매

실험 절차

Potassium cyanide (2.6g) was added to a stirred, two-phase mixture of 4-(chloromethyl)biphenyl (2.02g) and tetrabutyl ammonium hydrogen sulphate (200 mg) in dichloromethane (50 ml). The reaction mixture was stirred at ambient temperature for 36 hours. The organic layer was separated and washed with water (10 ml), dried (MgS04) and evaporated to give a solid residue which was crystallised from n-hexane to give 4-(cyanomethyl)biphenyl (1.3g) as a solid, m.p. 95° C.; microanalysis, found: C, 86.3; H, 5.7; N, 7.2%; C14H11N .O.1H2O requires C, 86.2; H, 5.7; N, 7.18%.

후처리

  1. customThe organic layer was separated
  2. washwashed with water (10 ml)
  3. customdried (MgS04)
  4. customevaporated
  5. customto give a solid residue which
  6. customwas crystallised from n-hexane

출처 및 근거

ORD 기록
ord-08baa463e22241db85abdbcd11810cd7
출처 데이터셋
uspto-grants-1998_06
특허 번호
US05770608

연결된 노트

불러오는 중…