Water → HCID 22557472, 화합물

HRID 984059노트

반응식

HRID 984059 반응식
[O:1]([C:8]1[CH:13]=[CH:12][C:11](B(O)O)=[CH:10][CH:9]=1)[C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][CH:3]=1.[NH2:17][C:18]1[C:19]([C:26]([NH2:28])=[O:27])=[N:20][C:21](Cl)=[C:22]([NH2:24])[N:23]=1.C(=O)([O-])[O-].[Na+].[Na+].O>C1(C)C=CC=CC=1.C(O)C.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[NH2:17][C:18]1[C:19]([C:26]([NH2:28])=[O:27])=[N:20][C:21]([C:11]2[CH:12]=[CH:13][C:8]([O:1][C:2]3[CH:7]=[CH:6][CH:5]=[CH:4][CH:3]=3)=[CH:9][CH:10]=2)=[C:22]([NH2:24])[N:23]=1

참가 물질

8

반응물 4

HCID 962WaterHCID 10340Sodium CarbonateHCID 6043433,5-Diamino-6-chloropyrazine-2-carboxamideHCID 27343774-Phenoxyphenylboronic acid

생성물 1

HCID 22557472HCID 22557472, 화합물수율 27.4%

시약·촉매·용매 3

HCID 178418397HCID 178418397, 화합물촉매HCID 702Ethanol용매HCID 1140Toluene용매

실험 절차

To a mixture of 4-phenoxyphenylboronic acid (0.22 g, 1.02 mmol), 3,5-diamino-6-chloropyrazine-2-carboxamide (0.176 g, 0.919 mmol), sodium carbonate (0.33 g, 2.06 mmol) in toluene (14 mL), ethanol (3.5 mL), and water (3.5 mL) was added tetrakis(triphenylphosphine)palladium (60 mg). The mixture was refluxed overnight. The reaction was allowed to cool to room temperature, then partitioned between water and ethyl acetate. The aqueous layer was extracted one more time with ethyl acetate. The combined organic layers were washed with water, dried over sodium sulfate, filtered, and evaporated under reduced pressure to give the crude product as a solid. Flash chromatography (Silica gel; 6:4 ethyl acetate/dichloromethane to 7:3 ethyl acetate/dichloromethane) and subsequent recrystalization from chloroform afforded 81 mg (27%) of the desired product as white solid. 1H NMR (CDCl3): δ 7.58 (d, J=9.0 Hz, 2H), 7.37 (t, J=7.8 Hz, 2H), 7.38 (bs, 1H), 7.15 (t, J=8.4 Hz, 1H), 7.10-7.05 (m, 4H), 5.26 (bs, 1H), 4.97 (s, 4H).

후처리

  1. temperatureThe mixture was refluxed overnight
  2. custompartitioned between water and ethyl acetate
  3. extractionThe aqueous layer was extracted one more time with ethyl acetate
  4. washThe combined organic layers were washed with water
  5. dry with materialdried over sodium sulfate
  6. filtrationfiltered
  7. customevaporated under reduced pressure
  8. customto give the crude product as a solid
  9. customFlash chromatography (Silica gel; 6:4 ethyl acetate/dichloromethane to 7:3 ethyl acetate/dichloromethane) and subsequent recrystalization from chloroform

출처 및 근거

ORD 기록
ord-98d2ce912cc6450ca64e53c926ccf2e1
출처 데이터셋
uspto-grants-2005_03
특허 번호
US06867210B2

반응 노트

불러오는 중…