5-Dimethylthiocarbamoyloxy-benzofuran-2-carboxylic acid methyl ester → Methyl 5-hydroxybenzofuran-2-carboxylate

HRID 984107노트

반응식

HRID 984107 반응식
[CH3:1][O:2][C:3]([C:5]1[O:6][C:7]2[CH:13]=[CH:12][C:11]([O:14]C(=S)N(C)C)=[CH:10][C:8]=2[CH:9]=1)=[O:4]>C1(OC2C=CC=CC=2)C=CC=CC=1>[CH3:1][O:2][C:3]([C:5]1[O:6][C:7]2[CH:13]=[CH:12][C:11]([OH:14])=[CH:10][C:8]=2[CH:9]=1)=[O:4]

참가 물질

3

반응물 1

HCID 207660095-Dimethylthiocarbamoyloxy-benzofuran-2-carboxylic acid methyl ester

생성물 1

HCID 12208973Methyl 5-hydroxybenzofuran-2-carboxylate수율 64.2%

시약·촉매·용매 1

HCID 7583Diphenyl Ether용매

실험 절차

A solution of 5-dimethylthiocarbamoyloxy-benzofuran-2-carboxylic acid methyl ester (1.3 g, 4.7 mmol) in 25 mL diphenyl ether was heated at reflux for 2.5 hours. The reaction mixture was then cooled and the resulting precipitate collected. Purification by flash column chromatography (gradient elution: 100% hexanes to 45% EtOAc/hexanes), gave the title compound (0.58 g, 45%) as a brown solid.

후처리

  1. temperatureat reflux for 2.5 hours
  2. temperatureThe reaction mixture was then cooled
  3. customthe resulting precipitate collected
  4. customPurification
  5. washby flash column chromatography (gradient elution: 100% hexanes to 45% EtOAc/hexanes)

출처 및 근거

ORD 기록
ord-066f150d61c14a148738f5535dffe990
출처 데이터셋
uspto-grants-2005_03
특허 번호
US06867224B2

반응 노트

불러오는 중…