4-(3-Chloropropyl)morpholine → HCID 20303044, compound

HRID 1732877Notes

Reaction equation

HRID 1732877 reaction equation
[CH2:1]([N:3]([CH2:8][CH3:9])[C:4]([NH:6][CH3:7])=[O:5])[CH3:2].[Cl:10][CH2:11][CH2:12][CH2:13][N:14]1[CH2:19][CH2:18][O:17][CH2:16][CH2:15]1>O1CCOCC1>[ClH:10].[CH2:1]([N:3]([CH2:8][CH3:9])[C:4]([N:6]([CH3:7])[CH2:11][CH2:12][CH2:13][N:14]1[CH2:19][CH2:18][O:17][CH2:16][CH2:15]1)=[O:5])[CH3:2]

Participants

4

Reactant 2

HCID 958344-(3-Chloropropyl)morpholineHCID 135031N,N-Diethyl-N'-methylurea

Product 1

HCID 20303044HCID 20303044, compound

Reagents, catalysts & solvents 1

HCID 312751,4-DioxaneSolvent2×

Procedure

13 g (0.1 mole) of N,N-diethyl-N'methyl urea are dissolved in 100 cc. of anhydrous dioxane. 3.9 g (0.1 mole) of NaNH2 are added thereto and the reaction mixture is heated one hour at reflux. After cooling, 16.4 g (0.1 mole) of N-(3-chloropropyl)morpholine dissolved in 50 cc. of anhydrous dioxane are added thereto dropwise and the reaction mixture is refluxed for 6 hours. After cooling, the precipitated NaCl is filtered off with suction, the filtrate is evaporated and the remaining residue is subjected to fractionated distillation.

Workup

  1. temperaturethe reaction mixture is heated one hour
  2. temperatureat reflux
  3. temperatureAfter cooling
  4. temperaturedropwise and the reaction mixture is refluxed for 6 hours
  5. temperatureAfter cooling
  6. filtrationthe precipitated NaCl is filtered off with suction
  7. customthe filtrate is evaporated
  8. distillationthe remaining residue is subjected to fractionated distillation

Sources & evidence

ORD record
ord-8bbe7d843dbb45bd82108f180c340889
Source dataset
uspto-grants-1980_12
Patent number
US04239761

Reaction notes

Loading…