HCID 23347045, compound → 1-Propanethiol, 3-(triethoxysilyl)-

HRID 1855942Notes

Reaction equation

HRID 1855942 reaction equation
[CH2:1]([O:3][Si:4]([O:13][CH2:14][CH3:15])([O:10][CH2:11][CH3:12])[CH2:5][CH2:6][C:7](N)=[S:8])[CH3:2]>[Re](=S)(=S)(=S)(=S)(=S)(=S)=S.C(O)C>[SH:8][CH2:7][CH2:6][CH2:5][Si:4]([O:13][CH2:14][CH3:15])([O:3][CH2:1][CH3:2])[O:10][CH2:11][CH3:12]

Participants

4

Reactant 1

HCID 23347045HCID 23347045, compound

Product 1

HCID 846581-Propanethiol, 3-(triethoxysilyl)-

Reagents, catalysts & solvents 2

HCID 178528043HCID 178528043, compoundCatalystHCID 702EthanolSolvent

Procedure

Into a clean, dry 300 cubic centimeter high pressure reactor were added 58 grams (0.23 moles) of beta-triethoxysilylthiopropionamide product (Example II pilot plant lot containing 5% beta-cyanoethyltriethoxysilane starting material), 1.45 grams (2.5 weight percent) of rhenium heptasulfide catalyst (Re2S7.2H2O), and 12 grams ethanol rinse. The reactor was sealed, initially pressurized to 800 psig with hydrogen, and placed in a rocker. The vessel was heated with agitation for 4 hours to a maximum pressure of 1000 psig. After cooling to ambient temperature, the pressure was 0 psig, indicating that hydrogen was consumed by the reaction. The reaction had produced gamma-mercaptopropyltriethoxysilane.

Workup

  1. customInto a clean, dry 300 cubic centimeter high pressure reactor
  2. washrinse
  3. customThe reactor was sealed
  4. temperatureThe vessel was heated with agitation for 4 hours to a maximum pressure of 1000 psig
  5. customwas consumed by the reaction

Sources & evidence

ORD record
ord-4f3171bb360a47e8b75f045d8ee9185b
Source dataset
uspto-grants-1980_08
Patent number
US04217294

Reaction notes

Loading…