HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(2S)-3-carboxy-2-hydroxy-N,N,N-trimethylpropan-1-aminium
(S)-Carnitine · D-Vitamin BT · (+)-Carnitine · D-CARNITINEHCL · Carnitine D-form · D(+)-Carnitine,98% · L-carnitine Impurity 1 · D(+)-Carnitine USP/EP/BP
Identifikatoren & physikalische Daten
| CAS No. | 541-14-0 |
|---|---|
| Summenformel | C7H16NO3+ |
| Durchschnittliche Molmasse | 162,21 g/mol |
| Monoisotopische Masse | 162,11301837 g/mol |
| SMILES | C[N+](C)(C)C[C@@H](O)CC(=O)O |
| InChIKey | PHIQHXFUZVPYII-LURJTMIESA-O |
| PubChem CID | 160907 |
| ChEBI | CHEBI:51453 |
| DTXSID | DTXSID20859370 |
Chemische & physikalische Eigenschaften
| XLogP | -0,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 57,5 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 11 |
| Formalladung | 1 |
| Komplexität | 139 |
| Schmelzpunkt | 197 °C |
| Siedepunkt | 287.5°C (rough estimate) |
| Dichte | 1.1587 (rough estimate) |
| Brechungsindex | 1.4500 (estimate) |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| Löslichkeit | Methanol (Slightly), Water (Slightly) |
| Aggregatzustand | Solid |
| Farbe | White to Off-White |
| Merck | 13,1862 |
| Stabilität | Hygroscopic |
| InChI | InChI=1/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/s3 |
| InChIKey | PHIQHXFUZVPYII-ISZMHOAENA-N |
| SMILES | C([C@@H](O)CC(=O)[O-])[N+](C)(C)C |&1:1,r| |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29391900 |
| RTECS-Nr. | BP2979850 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36-37/39 |
| Gefahrenklasse | IRRITANT |
Anwendungen & Verwendung
Verwenden
Essential cofactor of fatty acid metabolism; required for the transport of fatty acids through the inner mitochondrial membrane. Synthetized primarily in the liver and kidney; highest concentrations found in heart and skeletal muscle. Dietary sources include red meat, dairy products, beans, avocado.