HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Amfenac
SOYCMDCMZDHQFP-UHFFFAOYSA-N · Nepafenac Impurity 5(Amfenac) · 2-Amino-3-benzoylbenzeneacetic acid · Benzeneacetic acid, 2-amino-3-benzoyl- · Amfenac D5Q: What is Amfenac D5 Q: What is the CAS Number of Amfenac D5 Q: What is the storage condition of Amfenac D5 Q: What are the applications of Amfenac D5
Identifikatoren & physikalische Daten
| CAS No. | 51579-82-9 |
|---|---|
| Summenformel | C15H13NO3 |
| Durchschnittliche Molmasse | 255,27 g/mol |
| Monoisotopische Masse | 255,08954328 g/mol |
| SMILES | Nc1c(CC(=O)O)cccc1C(=O)c1ccccc1 |
| InChIKey | SOYCMDCMZDHQFP-UHFFFAOYSA-N |
| PubChem CID | 2136 |
| ChEMBL | CHEMBL25146 |
| ChEBI | CHEBI:75915 |
| DTXSID | DTXSID90199533 |
Chemische & physikalische Eigenschaften
| XLogP | 2,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 80,4 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 336 |
| Schmelzpunkt | 121-123° (dec) |
| Siedepunkt | 398.5°C (rough estimate) |
| Dichte | 1.1654 (rough estimate) |
| Brechungsindex | 1.5500 (estimate) |
Sicherheit & Vorschriften
| Toxizität | LD50 in mice, rats (mg/kg): 615, 311 orally (Sancilio) |
|---|
Anwendungen & Verwendung
Verwenden
Anti-inflammatory.