HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
6-Hydroxy-1,3-dimethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione
1,3-Dimethylvioluric acid · DMVA · Oxima-B · NSC 7370 · NSC 14273 · Oxyma Pure B · Oxyma-B anhydrous≥ 99% (HPLC) · Oxyma-B monohydrate≥ 99% (HPLC)
Identifikatoren & physikalische Daten
| CAS No. | 5417-13-0 |
|---|---|
| Summenformel | C6H7N3O4 |
| Durchschnittliche Molmasse | 185,14 g/mol |
| Monoisotopische Masse | 185,04365571 g/mol |
| SMILES | Cn1c(O)c(N=O)c(=O)n(C)c1=O |
| InChIKey | ZKKRUZAUFNFQRI-UHFFFAOYSA-N |
| PubChem CID | 222079 |
| DTXSID | DTXSID80970111 |
Chemische & physikalische Eigenschaften
| XLogP | -0,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 90,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 322 |
| Schmelzpunkt | 137-142°C |
| Siedepunkt | 312.370±25.00 °C(Press: 760.00 Torr)(predicted) |
| Dichte | 1.6g/cm3 |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | powder |
| pKa (Säurekonstante) | 6.812±0.20(predicted) |
| Hauptanwendungen | peptide synthesis |
| InChI | InChI=1S/C6H7N3O4/c1-8-4(10)3(7-13)5(11)9(2)6(8)12/h13H,1-2H3 |
| InChIKey | BVSCIXRAKUKIET-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C)C(=O)/C(=N/O)/C(=O)N1C |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | WGK 3 |
|---|---|
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
5-hydroxyimino-1,3-dimethyl-1,3-diazinane-2,4,6-trione is used as a coupling reagent, which shows superior properties in terms of minimizing racemization. The color changes from blue at the beginning of the reaction to yellowish green after completion.