HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-(2,6-dimethyl-3-nitrophenyl)acetamide
NSC 11344 · 3'-Nitro-2',6'-acetoxylidide · N-Acetyl-3-nitro-2,6-diMethylaniline · N-Acetyl-2,6-diMethyl-3-nitroaniline · N-(2,6-DiMethyl-3-nitrophenyl)acetaMide · Acetamide, N-(2,6-dimethyl-3-nitrophenyl)-
Identifikatoren & physikalische Daten
| CAS No. | 5416-12-6 |
|---|---|
| Summenformel | C10H12N2O3 |
| Durchschnittliche Molmasse | 208,21 g/mol |
| Monoisotopische Masse | 208,08479225 g/mol |
| SMILES | CC(=O)Nc1c(C)ccc([N+](=O)[O-])c1C |
| InChIKey | UNIUJJXVDIYVQM-UHFFFAOYSA-N |
| PubChem CID | 223591 |
| ChEMBL | CHEMBL2131796 |
| DTXSID | DTXSID40279132 |
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 74,9 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 262 |
| Schmelzpunkt | 165 °C(Solv: hexane (110-54-3)benzene (71-43-2)) |
| Siedepunkt | 354.2±30.0 °C(Predicted) |
| Dichte | 1.247±0.06 g/cm3(Predicted) |
| Lagerbedingungen | -20°C Freezer |
| Löslichkeit | Methanol |
| pKa (Säurekonstante) | 14.22±0.70(Predicted) |
| Aggregatzustand | Solid |
| Farbe | White |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
NSC 11344 is a useful compound in the synthesis of furopyridinylaminoindazoles and imidazoles as Raf kinase inhibitors and in the synthesis of peptides, as hepatitis C virus inhibitors.