HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Cicletanine
Cicletanine · 3-(4-chlorophenyl)-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-ol · 3-(4-Chlorophenyl)-1,3-dihydro-6-methylfuro[3,4-c]pyridin-7-ol · Furo[3,4-c]pyridin-7-ol, 3-(4-chlorophenyl)-1,3-dihydro-6-methyl-
Identifikatoren & physikalische Daten
| CAS No. | 89943-82-8 |
|---|---|
| Summenformel | C14H12ClNO2 |
| Durchschnittliche Molmasse | 261,7 g/mol |
| Monoisotopische Masse | 261,0556563 g/mol |
| SMILES | Cc1ncc2c(c1O)COC2c1ccc(Cl)cc1 |
| InChIKey | CVKNDPRBJVBDSS-UHFFFAOYSA-N |
| PubChem CID | 54910 |
| ChEMBL | CHEMBL191886 |
| ChEBI | CHEBI:135078 |
| EC No. | 630-329-0 |
| DTXSID | DTXSID70868972 |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 42,4 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 294 |
| LogP (Verteilungskoeffizient) | 2.34 |
| Siedepunkt | 446.3±45.0 °C(Predicted) |
| Dichte | 1.351±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 5.37±0.40(Predicted) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH318 (100%): Causes serious eye damage [Danger Serious eye damage/eye irritation]P264+P265, P280, P305+P354+P338, and P317 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Eye Dam. 1 (100%) |
| Alarmwort | Achtung |
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H318 |
Anwendungen & Verwendung
Verwenden
Antihypertensive.