HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Aminonaphthalin-1,6-disulfonsure
Dahl's acid III · 1-naphthylamine-4,7-disulfonic acid · 4-aminonaphthalene-1,6-disulfonic acid · 4-Amino-1,6-naphthalenedisulfonic acid · 4-aminonaphthalene-1,6-disulphonic acid · 4-azanylnaphthalene-1,6-disulfonic acid · 1,6-Naphthalenedisulfonic acid, 4-amino-
Identifikatoren & physikalische Daten
| CAS No. | 85-75-6 |
|---|---|
| Summenformel | C10H9NO6S2 |
| Durchschnittliche Molmasse | 303,3 g/mol |
| Monoisotopische Masse | 302,98712901 g/mol |
| SMILES | Nc1ccc(S(=O)(=O)O)c2ccc(S(=O)(=O)O)cc12 |
| InChIKey | QUFFRITXLMVPMV-UHFFFAOYSA-N |
| PubChem CID | 66567 |
| EC No. | 201-630-0 |
| DTXSID | DTXSID0058930 |
| Lokaler Name | 4-Aminonaphthalin-1,6-disulfonsure |
Chemische & physikalische Eigenschaften
| XLogP | 0 |
|---|---|
| Polarare Oberfläche (TPSA) | 152 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 7 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 531 |
| Siedepunkt | 205.8°C (rough estimate) |
| Dichte | 1.6329 (rough estimate) |
| Brechungsindex | 1.7330 (estimate) |
| EPA chemische Informationen | 1,6-Naphthalenedisulfonic acid, 4-amino- (85-75-6) |
Sicherheit & Vorschriften
| TSCA-Inventar-Status | TSCA listed |
|---|---|
| UN-Transportnummer | 1759 |
| Gefahrenklasse | 8 |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Beschreibung
1-Aminonaphthalene-4,7-disulfonic acid [85-75-6]. (4-aminonaphthalene-1,6-disulfonic acid), Dahl’s acid III, C10H9NO6S2, Mr 303.3, and its sodium salt are readily soluble in water, but the calcium and barium salts are only sparingly soluble. Conversion to 1-hydroxynaphthalene-4,7-disulfonic acid is achieved by reverse-Bucherer reaction or diazotization and hydrolysis. Sulfonation (35 % oleum, 90℃) yields 1-aminonaphthalene-2,4,7-trisulfonic acid.