HuagongsheHuagongshe Chemistry Print Report · For research reference only
Aprindine Hydrochloride
APRINDINE HYDROCHLORIDE · ms-5075 · fiboran · aspenon · Fibocil · Amidonal · Aprindina · APRINDINE HCL
Identifiers & Physical Properties
| CAS No. | 33237-74-0 |
|---|---|
| Molecular formula | C22H31ClN2 |
| Average molar mass | 358.9 g/mol |
| Monoisotopic mass | 358.2175767 g/mol |
| SMILES | CCN(CC)CCCN(c1ccccc1)C1Cc2ccccc2C1.Cl |
| InChIKey | KIPFVRHNAAZJOD-UHFFFAOYSA-N |
| PubChem CID | 71413 |
| ChEMBL | CHEMBL2104501 |
| ChEBI | CHEBI:31229 |
| EC No. | 251-418-7 |
| DTXSID | DTXSID5046726 |
Chemical & Physical Properties
| Topological polar surface area | 6.5 |
|---|---|
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 8 |
| Heavy atoms | 25 |
| Formal charge | 0 |
| Complexity | 332 |
| Melting point | 120-121° |
| Storage conditions | 2-8°C |
| Solubility | H2O: >10mg/mL |
| Physical state | solid |
| Color | Light Brown to Brown |
| Stability | Hygroscopic |
| InChI | InChI=1S/C22H30N2.ClH/c1-3-23(4-2)15-10-16-24(21-13-6-5-7-14-21)22-17-19-11-8-9-12-20(19)18-22/h5-9,11-14,22H,3-4,10,15-18H2,1-2H31H |
| InChIKey | KIPFVRHNAAZJOD-UHFFFAOYSA-N |
| SMILES | C1(CC2C=CC=CC=2C1)N(CCCN(CC)CC)C1C=CC=CC=1.Cl |
| FDA UNII | PB5EKT7Q2V |
| UNSPSC Code | 12352200 |
| NACRES | NA.77 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H302-H315-H319-H335 |
| GHS precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard symbols | Xn |
| Risk statements (R) | 22-36/37/38 |
| Safety statements (S) | 26 |
| Water hazard class (WGK) | 3 |
| RTECS number | TX7386000 |
| Storage class | 11 - Combustible Solids |
| Hazard class | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
Safety & Regulations
| GHS classification | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| RTECS number | TX7386000 |
| Risk statements (R) | 22-36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xn |
| Safety statements (S) | 26 |
| Storage class | 11 - Combustible Solids |
| Target organs | Respiratory system |
| GHS hazard statements | H302-H315-H319-H335 |
| Hazard class | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| GHS precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
Applications & Uses
Uses
Aprindine is a long-acting antiarrhythmic agent, effective when administered orally or intravenously in the treatment of ventricular arrhythmias of varying etiologies.