Morpholine → Ethyl 2,6-dimethyl-3-(propan-2-yl)benzoate

HRID 354544

Reaction equation

HRID 354544 reaction equation
N1CCOC[CH2:2]1.[CH:7](=O)[CH2:8][CH:9](C)C.S([O-])([O-])(=O)=O.[Mg+2].[CH3:19][C:20]1[C:25]([C:26]([O:28][CH2:29][CH3:30])=[O:27])=[C:24]([CH3:31])O[C:22](=O)[CH:21]=1>C1(C)C=CC(S(O)(=O)=O)=CC=1.C1(C)C=CC=CC=1>[CH3:19][C:20]1[C:21]([CH:8]([CH3:9])[CH3:7])=[CH:22][CH:2]=[C:24]([CH3:31])[C:25]=1[C:26]([O:28][CH2:29][CH3:30])=[O:27]

Participants

7

Reactant 4

HCID 8083MorpholineHCID 115523-MethylbutanalHCID 24083Sulfuric acid magnesium salt (1:1)HCID 76918ethyl 4,6-dimethyl-2-oxo-2H-pyran-5-carboxylate

Product 1

HCID 13126300Ethyl 2,6-dimethyl-3-(propan-2-yl)benzoateYield 8.3%

Reagents, catalysts & solvents 2

HCID 6101p-Toluenesulfonic acidCatalystHCID 1140TolueneSolvent

Procedure

Morpholine (13.34 g), isovaleraldehyde (13.18 g), p-toluenesulfonic acid (0.2 g), and toluene (300 ml) were combined and heated at reflux using a Soxhlet extractor with magnesium sulfate to remove any water produced. After three hours the Soxhlet extractor was replaced with a condenser, and ethyl 4,6-dimethyl-2-oxo-2H-pyran-5-carboxylate (30 g) was added. The reaction mixture was heated under reflux for approximately 64 hours. The solvent was evaporated, and the resultant oil was distilled to give 11.1 g of crude product which was chromatographed to yield ethyl 2,6-dimethyl-3-(1-methylethyl)benzoate (2.8 g).

Workup

  1. temperatureheated
  2. temperatureat reflux
  3. customto remove any water
  4. customproduced
  5. temperatureThe reaction mixture was heated
  6. temperatureunder reflux for approximately 64 hours
  7. customThe solvent was evaporated
  8. distillationthe resultant oil was distilled
  9. customto give 11.1 g of crude product which
  10. customwas chromatographed

Sources & evidence

ORD record
ord-3deaa738e08b489ea56184426ebd4810
Source dataset
uspto-grants-1983_03
Patent number
US04375476

Linked notes

Loading…