Ammonia → 2,2,4,4,6,6-Hexamethylcyclotrisilazane

HRID 5618

Reaction equation

HRID 5618 reaction equation
[CH3:1][Si:2]([CH3:5])(Cl)Cl.[NH3:6]>C1(C)C=CC=CC=1>[CH3:1][Si:2]1([CH3:5])[NH:6][Si:2]([CH3:5])([CH3:1])[NH:6][Si:2]([CH3:5])([CH3:1])[NH:6]1

Participants

4

Reactant 2

HCID 222AmmoniaHCID 6398Dichlorodimethylsilane

Product 1

HCID 660942,2,4,4,6,6-HexamethylcyclotrisilazaneYield 42.1%

Reagents, catalysts & solvents 1

HCID 1140TolueneSolvent

Procedure

A 500-ml, four-necked flask equipped with a stirrer, dry ice/acetone condenser, thermometer, and gas inlet tube was charged with 64.5 grams (0.5 mol) of dimethyldichlorosilane and 150 grams of toluene. Into the solution at 30° C., 52 grams (3.06 mol) of ammonia was blown over 2 hours for effecting reaction. At the end of reaction, the reaction solution was passed through a glass filter to remove ammonium chloride resulting from the reaction. The filtrate was subjected to vacuum distillation, obtaining 15.4 grams of hexamethylcyclotrisilazane (yield 42%).

Workup

  1. customA 500-ml, four-necked flask equipped with a stirrer, dry ice/acetone condenser
  2. customAt the end of reaction
  3. filtrationfilter
  4. customto remove ammonium chloride resulting
  5. customfrom the reaction
  6. distillationThe filtrate was subjected to vacuum distillation

Sources & evidence

ORD record
ord-8e84db8ce536415d96651b7838d19504
Source dataset
uspto-grants-1993_09
Patent number
US05245066

Linked notes

Loading…