인디루빈-3'-모녹심
인디루빈-3'-모녹심 · -oxime · -monoxime · Indirubin-3 · Indirubin-3′INDIRUBIN-3'-OXIME · Indirubine-3'-oxime · Indirubin-3'-monoxime · INDIRUBIN-3’-MONOOXIME
식별자 및 물리적 특성
| CAS No. | 160807-49-8 |
|---|---|
| 분자식 | C16H11N3O2 |
| 평균 분자량 | 277.28 g/mol |
| 단동위원소 질량 | 277.0851266 g/mol |
| SMILES | O=Nc1c(-c2c(O)[nH]c3ccccc23)[nH]c2ccccc12 |
| InChIKey | FQCPPVRJPILDIK-UHFFFAOYSA-N |
| PubChem CID | 3707 |
| ChEMBL | CHEMBL126077 |
| ChEBI | CHEBI:43645 |
| DTXSID | DTXSID90416111 |
| 현지명 | 인디루빈-3'-모녹심 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 81.2 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 405 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| 녹는점 | 247-249°C |
| 끓는 점 | 532.2±50.0 °C(Predicted) |
| 밀도 | 1.50 |
| 저장 조건 | room temp |
| 용해도 | DMSO: >10mg/mL |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 8.66±0.20(Predicted) |
| 색상 | 진한 빨간색 또는 갈색 |
| 안정성 | 감광성 |
| InChIKey | HBDSHCUSXQATPO-UHFFFAOYSA-N |
화학적 성질
Dark Red Solid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 저장 분류 | 11 - Combustible Solids |
용도
개요
Indirubin-3’-oxime is a potent inhibitor of glycogen synthase kinase 3β (GSK3β; IC50 = 22 nM). As GSK3β phosphorylates tau protein, indirubin-3’-oxime prevents tau phosphorylation both in vitro and in vivo at Alzheimer’s disease-relevant sites. It also inhibits cyclin-dependent kinases (CDKs) at higher concentrations, including Cdk1/cyclin B (IC50 = 180 nM), Cdk2/cyclin A (IC50 ~500 nM), Cdk2/cyclin E (IC50 = 250nM), Cdk4/cyclin D1 (IC50 = 3.3 μM) and Cdk5/p35 (IC50 = 100 nM). Indirubin-3’-oxime reversibly inhibits the proliferation of many cells types, arresting cycling in the G2/M phase.
용도
A potent inhibitor of GSK-3 (IC50=22nM). Also inhibits CDK1 (IC50=180nM) and CDK (IC50=100nM). It reversibly arrests asynchronous HBL-100 cells at G2. It induces apoptosis in the mammary carcinoma cell line MCF-7 (10üM).