글루타티온
글루타티온 · GSH · L-GLUTATHIONE REDUCED · REDUCED GLUTATHIONE · glutatione · Glutathion · Liposomal Glutathione · Glutathione powder
식별자 및 물리적 특성
| CAS No. | 70-18-8 |
|---|---|
| 분자식 | C10H17N3O6S |
| 평균 분자량 | 307.33 g/mol |
| 단동위원소 질량 | 307.08380626 g/mol |
| SMILES | NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)O |
| InChIKey | RWSXRVCMGQZWBV-UHFFFAOYSA-N |
| PubChem CID | 745 |
| ChEMBL | CHEMBL100476 |
| ChEBI | CHEBI:177535 |
| DTXSID | DTXSID70859082 |
| 현지명 | 글루타티온 |
화학 및 물리적 성질
| XLogP | -4.5 |
|---|---|
| 극성 표면적 | 160 |
| 수소 결합 공여자 수 | 6 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 9 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 389 |
| 녹는점 | 192-195 °C (dec.) (lit.) |
| 끓는 점 | 754.5±60.0 °C(Predicted) |
| 밀도 | 1.4482 (rough estimate) |
| 굴절률 | -17 ° (C=2, H2O) |
| 저장 조건 | 2-8°C |
| 용해도 | H2O: 50 mg/mL |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | pK1 2.12pK2 3.53pK3 8.66pK4 9.12(at 25℃) |
| 색상 | 하얀색 |
| pH | 3 (10g/l, H2O, 20°C) |
| 냄새 | 냄새 없는 |
| 용해도 | 녹는 |
| Merck | 14,4475 |
| BRN | 1729812 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| 화장품 원료 기능 | 피부의 산화 스트레스를 줄이세요 |
| InChI | 1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O)C(O)=O |
| LogP(분배 계수) | -1.645 (est) |
| EPA | Glutathione (70-18-8) |
화학적 성질
White cryst. powder
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | MC0556000 |
| 관세 코드 | 29309070 |
| 위험 문구(R) | 68-36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25-36/37/39-27-26 |
| 기존화학 물질 | KE-17781 |
| F 고인화성물질 | 9-23 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
자연계에 널리 분포하여 동물, 효소 등 거의 모든 생체 내의 산화환원반응에 중요한 역할을 한다. 일부 미생물의 성장인자이고, 효소 글리옥살라아제의 조효소이며, 또 SH기를 가진 효소(카텝신 등)의 활성화에도 관여한다.
개요
Glutathione (GSH) is a tripeptide (γ-glutamylcysteinylglycine) widely distributed in both plants and animals. GSH serves as a nucleophilic co-substrate to glutathione transferases in the detoxification of xenobiotics and is an essential electron donor to glutathione peroxidases in the reduction of hydroperoxides. GSH is also involved in amino acid transport and maintenance of protein sulfhydryl reduction status. The concentration of GSH ranges from a few micromolar in plasma to several millimolar in tissues such as liver.
일반 설명
Glutathione (GSH) is the most important nonprotein thiol widely distributed in animal tissues, plants, and microorganisms. GSH is also a key determinant of redox signaling and protection against oxidative stress.Pharmaceutical secondary standards for application in quality control, provide pharma laboratories and manufacturers with a convenient and cost-effective alternative to the preparation of in-house working standards.