5-아미노플루오레세인
5-아미노플루오레세인 · FLUORESCEINAMINE · 5-AF · AMINOFLUORESCEIN · 5-AFM · 4-AMINOFLUORESCEIN · 5-amino-3',6'-dihydroxy-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one · 5-AMF
식별자 및 물리적 특성
| CAS No. | 3326-34-9 |
|---|---|
| 분자식 | C20H13NO5 |
| 평균 분자량 | 347.3 g/mol |
| 단동위원소 질량 | 347.07937252 g/mol |
| SMILES | Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChIKey | GZAJOEGTZDUSKS-UHFFFAOYSA-N |
| PubChem CID | 76845 |
| ChEMBL | CHEMBL5284644 |
| ChEBI | CHEBI:91078 |
| EC No. | 222-043-6 |
| DTXSID | DTXSID0062979 |
| 현지명 | 5-아미노플루오레세인 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 102 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 26 |
| 형식 전하 | 0 |
| 복잡도 | 557 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 223 °C (dec.)(lit.) |
| 끓는 점 | 481.89°C (rough estimate) |
| 밀도 | 1.3724 (rough estimate) |
| 굴절률 | 1.5180 (estimate) |
| 저장 조건 | room temp |
| 용해도 | DMF: 5 mg/mlDMSO: 5 mg/ml |
| pKa(산도 계수) | 9.34±0.20(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 적갈색 |
| 용해도 | 물(일부), 메탄올(10mg/ml) 및 아세톤에 용해됩니다. |
| BRN | 48395 |
| 안정성 | 빛과 습기에 민감함 |
| 주요 응용 | 진단 검사 제조혈액학조직학 |
| InChI | 1S/C20H13NO5/c21-10-1-4-14-13(7-10)19(24)26-20(14)15-5-2-11(22)8-17(15)25-18-9-12(23)3-6-16(18)20/h1-9,22-23H,21H2 |
| InChIKey | GZAJOEGTZDUSKS-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)OC23c4ccc(O)cc4Oc5cc(O)ccc35 |
| EPA | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 5-amino-3',6'-dihydroxy- (3326-34-9) |
화학적 성질
Dark Red Solid
안전 및 규제
| GHS 분류 | WarningH302 (98.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 85 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (98.8%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 32049090 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26 |
| F 고인화성물질 | 10 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Glycosaminoglycuronans react with 5-aminofluorescein to yield fluorescent derivatives. 5-aminofluorescein is also used to prepare FITC Isomer I (F-011, F-020).
일반 설명
Fluoresceinamine, isomer I belongs to the class of derivatized fluoresceins.
제조 및 합성 방법
제조 방법
The preparation of 5-aminofluorescein is carried out either by first saponification of 5-nitrofluorescein acetates with alcohol alkali, followed by reduction of the obtained 5-nitrofluorescein in a solution of alcohol alkali with hydrazine hydrate on a nickel catalyst to obtain 5-aminofluorescein , Or by boiling in an aqueous solution of sodium sulfide. The restoration of the nitro group and the saponification of acetates in the second case occurs in one stage.