2-Methoxybenzonitrile
AKOS 91422 · AKOS B005792 · O-CYANOANISOLE · 2-CYANOANISOLE · o-Anisonitrile · 2-Methxybenzonitrile · 2-Methoxybenzonitril · 2-METHOXYBENZONITRILE
식별자 및 물리적 특성
| CAS No. | 6609-56-9 |
|---|---|
| 분자식 | C8H7NO |
| 평균 분자량 | 133.15 g/mol |
| 단동위원소 질량 | 133.05276384 g/mol |
| SMILES | COc1ccccc1C#N |
| InChIKey | FSTPMFASNVISBU-UHFFFAOYSA-N |
| PubChem CID | 81086 |
| EC No. | 229-559-0 |
| DTXSID | DTXSID10216291 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 33 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 147 |
| SpringerMaterials Properties | Density |
| 녹는점 | 24.5°C |
| 끓는 점 | 135 °C12 mm Hg(lit.) |
| 밀도 | 1.093 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.5465(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 물에 약간 용해됨 |
| 물리적 상태 | 액체 |
| 색상 | 무색~담황색 투명 |
| BRN | 2207134 |
| InChI | InChI=1S/C8H7NO/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
| InChIKey | FSTPMFASNVISBU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC=C1OC |
| NIST | o-Methoxybenzonitrile(6609-56-9) |
화학적 성질
Colorless liquid
안전 및 규제
| GHS 분류 | WarningH302 (14.6%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (14.6%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 3276 |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 포장분류 | III |
| 위험 등급 | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2-Methoxybenzonitrile was used in the synthesis of 5-(4′-methyl [1,1′-biphenyl]-2-yl)-1H-tetrazole.
일반 설명
Surface-enhanced Raman spectra study of 2-methoxybenzonitrile has been reported.
제조 및 합성 방법
제조 방법
o-Anisidine with sodium nitrite to make a diazonium salt solution, add it to the lead cyanide solution, and then add benzene. Put the mixture for 10-15h and carry out steam distillation, separate the benzene layer from the distillate, dry it with calcium chloride, evaporate the benzene, and distill the residue under reduced pressure, collect 120-122.5°C (1.2kPa fraction) to get 2-Methoxybenzonitrile, yield 64.5-67.3%.