Triethylamine → HCID 22200564, 화합물

HRID 1014233노트

반응식

HRID 1014233 반응식
[Cl:1][C:2]1[CH:8]=[CH:7][C:5]([NH2:6])=[CH:4][C:3]=1[N+:9]([O-:11])=[O:10].C1COCC1.ClCCCl.C(N(CC)CC)C.Cl.[CH3:29][N:30]([CH3:35])[CH2:31][C:32](Cl)=[O:33]>CN(C1C=CN=CC=1)C.ClCCl>[Cl:1][C:2]1[CH:8]=[CH:7][C:5]([NH:6][C:32](=[O:33])[CH2:31][N:30]([CH3:35])[CH3:29])=[CH:4][C:3]=1[N+:9]([O-:11])=[O:10]

참가 물질

7

반응물 4

HCID 8471TriethylamineHCID 124774-Chloro-3-nitroanilineHCID 139949912-(Dimethylamino)acetyl chloride hydrochlorideHCID 21493386Dce thf

생성물 1

HCID 22200564HCID 22200564, 화합물수율 67%

시약·촉매·용매 2

HCID 142844-(Dimethylamino)pyridine촉매HCID 6344Dichloromethane용매

반응 조건

온도
65 °C

실험 절차

To a solution of 4-chloro-3-nitroaniline (1.0 g, 5.81 mmol) in 1:1 THF/DCE (200 mL) was added triethylamine (3.53 g, 34.9 mmol, Aldrich), 2-dimethylaminoacetyl chloride hydrochloride (1.82 g, 11.6 mmol, Alfa Aesar), and catalytic DMAP (Aldrich). After heating overnight at 65° C., the crude reaction mixture was diluted with dichloromethane (300 mL), washed with saturated NaHCO3 (50 mL), evaporated, and purified by column chromatography (dichloromethane to 5% methanol/dichloromethane) to provide N1-(4-chloro-3-nitrophenyl)-N2,N2-dimethylglycinamide (1.0 g, 67%) as a brown solid. ESIMS (M+H)+=258.

후처리

  1. customthe crude reaction mixture
  2. washwashed with saturated NaHCO3 (50 mL)
  3. customevaporated
  4. custompurified by column chromatography (dichloromethane to 5% methanol/dichloromethane)

출처 및 근거

ORD 기록
ord-4eb89910d6a7436dba26eb7988e9f323
출처 데이터셋
uspto-grants-2011_07
특허 번호
US07981903B2

반응 노트

불러오는 중…