1,5-Dibromopentane → 1-[2-[(5-Bromopentyl)oxy]ethyl]-4-methoxybenzene

HRID 1084962

반응식

HRID 1084962 반응식
[CH3:1][O:2][C:3]1[CH:8]=[CH:7][C:6]([CH2:9][CH2:10][OH:11])=[CH:5][CH:4]=1.[Br:12][CH2:13][CH2:14][CH2:15][CH2:16][CH2:17]Br.[OH-].[Na+]>S(=O)(=O)(O)[O-].C([N+](CCCC)(CCCC)CCCC)CCC.O>[Br:12][CH2:13][CH2:14][CH2:15][CH2:16][CH2:17][O:11][CH2:10][CH2:9][C:6]1[CH:7]=[CH:8][C:3]([O:2][CH3:1])=[CH:4][CH:5]=1

참가 물질

6

반응물 3

HCID 81001,5-DibromopentaneHCID 14798Sodium HydroxideHCID 697054-Methoxyphenethyl alcohol

생성물 1

HCID 200628301-[2-[(5-Bromopentyl)oxy]ethyl]-4-methoxybenzene

시약·촉매·용매 2

HCID 94433Tetrabutylammonium hydrogen sulfate촉매HCID 962Water용매

실험 절차

A mixture of 4-methoxybenzeneethanol (7.0 g), 1,5-dibromopentane (20 ml), 50% aqueous sodium hydroxide (30 ml) and tetrabutylammonium bisulphate (1 g) was stirred at room temperature overnight, water (100 ml) wa added and the mixture was extracted with ER (2×100 ml). The organic extracts were washed with water and brine, dried and concentrated in vacuo to give an oil which was purified by FCC eluting with hexane→hexane-ER (9:1) to give the title compound as a colourless liquid (10.5 g). T.l.c. hexane-ER (9:1) Rf 0.28.

후처리

  1. extractionthe mixture was extracted with ER (2×100 ml)
  2. washThe organic extracts were washed with water and brine
  3. customdried
  4. concentrationconcentrated in vacuo
  5. customto give an oil which
  6. customwas purified by FCC
  7. washeluting with hexane→hexane-ER (9:1)

출처 및 근거

ORD 기록
ord-480c9ad7458d45a7aff014d7786fa990
출처 데이터셋
uspto-grants-1991_04
특허 번호
US05006556

연결된 노트

불러오는 중…