Succinyl chloride → 1-[4-(3-Chloro-4-hydroxy-phenylamino)-6-phenyl-pyrimidin-2-yl]-pyrrolidine-2,5-dione

HRID 1161693

반응식

HRID 1161693 반응식
[NH2:1][C:2]1[N:7]=[C:6]([NH:8][C:9]2[CH:14]=[CH:13][C:12]([OH:15])=[C:11]([Cl:16])[CH:10]=2)[CH:5]=[C:4]([C:17]2[CH:22]=[CH:21][CH:20]=[CH:19][CH:18]=2)[N:3]=1.[C:23](Cl)(=[O:29])[CH2:24][CH2:25][C:26](Cl)=[O:27]>CN(C)C=O.CN(C1C=CN=CC=1)C.O>[Cl:16][C:11]1[CH:10]=[C:9]([NH:8][C:6]2[CH:5]=[C:4]([C:17]3[CH:22]=[CH:21][CH:20]=[CH:19][CH:18]=3)[N:3]=[C:2]([N:1]3[C:26](=[O:27])[CH2:25][CH2:24][C:23]3=[O:29])[N:7]=2)[CH:14]=[CH:13][C:12]=1[OH:15]

참가 물질

6

반응물 2

HCID 10970Succinyl chlorideHCID 586261414-(2-Amino-6-phenyl-pyrimidin-4-ylamino)-2-chloro-phenol

생성물 1

HCID 115892931-[4-(3-Chloro-4-hydroxy-phenylamino)-6-phenyl-pyrimidin-2-yl]-pyrrolidine-2,5-dione

시약·촉매·용매 3

HCID 142844-(Dimethylamino)pyridine촉매HCID 962Water용매HCID 6228Dimethylformamide용매

실험 절차

To a solution of compound 4-(2-amino-6-phenyl-pyrimidin-4-ylamino)-2-chloro-phenol (0.5 g, 1.6 mmol) in dry dimethylformamide (10 mL) was added 4-(N,N-dimethylamino)pyridine (0.39 g, 3.2 mmol) at 0° C. with stirring under nitrogen atmosphere. To this was added freshly prepared succinyl chloride (0.62 g, 4 mmol). The mixture was then stirred at 80° C. for 20 hours. After completion of the reaction the mixture was diluted with water (75 mL), the solid separated was filtered off, washed with cold water (200 mL) and dried. The solid was purified further by column chromatography using petroleum ether-ethyl acetate to give the desired product as a light brown solid.

후처리

  1. stirringThe mixture was then stirred at 80° C. for 20 hours
  2. customAfter completion of the reaction the mixture
  3. customthe solid separated
  4. filtrationwas filtered off
  5. washwashed with cold water (200 mL)
  6. customdried
  7. customThe solid was purified further by column chromatography

출처 및 근거

ORD 기록
ord-00aa9bc38e134df8ab973a9e9f70ce33
출처 데이터셋
uspto-grants-2010_10
특허 번호
US07820654B2

연결된 노트

불러오는 중…