Allyl bromide → HCID 23117635, 화합물

HRID 1178323노트

반응식

HRID 1178323 반응식
[CH2:1]([O:3][C:4](=[O:22])[CH:5]([N:14]=[CH:15][C:16]1[CH:21]=[CH:20][CH:19]=[CH:18][CH:17]=1)[C:6]1[CH:11]=[CH:10][C:9]([Cl:12])=[C:8]([Cl:13])[CH:7]=1)[CH3:2].[CH2:23](Br)[CH:24]=[CH2:25].C(=O)([O-])[O-].[K+].[K+]>C(OCC)(=O)C.[Br-].C([N+](CCCC)(CCCC)CCCC)CCC>[CH:15](=[N:14][C:5]([C:6]1[CH:11]=[CH:10][C:9]([Cl:12])=[C:8]([Cl:13])[CH:7]=1)([CH2:25][CH:24]=[CH2:23])[C:4]([O:3][CH2:1][CH3:2])=[O:22])[C:16]1[CH:17]=[CH:18][CH:19]=[CH:20][CH:21]=1

참가 물질

6

반응물 3

HCID 7841Allyl bromideHCID 11430Potassium CarbonateHCID 58696280HCID 58696280, 화합물

생성물 1

HCID 23117635HCID 23117635, 화합물수율 94.2%

시약·촉매·용매 2

HCID 74236Tetrabutylammonium Bromide촉매HCID 8857Ethyl Acetate용매

실험 절차

Ethyl(benzylidene-amino)-(3,4-dichlorophenyl)-acetate (1.41 mol) was dissolved in ethyl acetate (2.3 L). Allyl bromide (341 g), potassium carbonate (390 g), and tetrabutylammonium bromide (45 g) were added to the resultant mixture, followed by refluxing for 2.5 hours. The reaction mixture was left to cool to room temperature. The mixture was sequentially washed with water and saturated brine, dried over sodium sulfate anhydrate, and concentrated under reduced pressure, to thereby give the title compound (500 g, 94%).

후처리

  1. temperatureby refluxing for 2.5 hours
  2. waitThe reaction mixture was left
  3. washThe mixture was sequentially washed with water and saturated brine
  4. dry with materialdried over sodium sulfate anhydrate
  5. concentrationconcentrated under reduced pressure

출처 및 근거

ORD 기록
ord-0e63fdad07464e2ba3a1878b7b301eee
출처 데이터셋
uspto-grants-2007_10
특허 번호
US07276511B2

반응 노트

불러오는 중…