Water → 1,1'-Oxybis(4-nitrobenzene)

HRID 1197140

반응식

HRID 1197140 반응식
[N+]([C:4]1[CH:9]=[CH:8][C:7]([N+:10]([O-:12])=[O:11])=[CH:6][CH:5]=1)([O-])=O.[C:13](=[O:16])([O-])[O-].[K+].[K+].[OH2:19]>CS(C)=O.ClC1C=CC(C(O)=O)=CC=1>[CH:6]1[C:7]([N+:10]([O-:11])=[O:19])=[CH:8][CH:9]=[C:13]([O:16][C:4]2[CH:5]=[CH:6][C:7]([N+:10]([O-:12])=[O:11])=[CH:8][CH:9]=2)[CH:5]=1

참가 물질

6

반응물 3

HCID 962WaterHCID 74921,4-DinitrobenzeneHCID 11430Potassium Carbonate

생성물 1

HCID 75681,1'-Oxybis(4-nitrobenzene)수율 80%

시약·촉매·용매 2

HCID 63184-Chlorobenzoic Acid촉매HCID 679Dimethyl Sulfoxide용매

실험 절차

1,4-Dinitrobenzene (3.52 g, 20.5 mmol), potassium carbonate (1.38 g, 10 mmol), and 4-chlorobenzoic acid (30 mg, 0.19 mmol) were heated in dimethylsulfoxide (8 mL) at about 100° C. for approximately 5.8 hours. The reaction was allowed to cool and was poured into water (20 mL). The reaction vessel was rinsed with an additional 10 mL of water and the rinses were combined. The combined aqueous suspensions were allowed to stand overnight. The solid was collected, washed with water, and dried to give 2.51 g (80% pure) of 4,4'-dinitrodiphenyl ether.

후처리

  1. temperatureto cool
  2. washThe reaction vessel was rinsed with an additional 10 mL of water
  3. customThe solid was collected
  4. washwashed with water
  5. customdried

출처 및 근거

ORD 기록
ord-cdf7e56ed48547298b149a94716807d0
출처 데이터셋
uspto-grants-1992_05
특허 번호
US05117002

연결된 노트

불러오는 중…