p-Nitroacetophenone → 3-(4-Nitrophenyl)-1H-pyrazole

HRID 1251466

반응식

HRID 1251466 반응식
[CH3:1][C:2]([C:4]1[CH:9]=[CH:8][C:7]([N+:10]([O-:12])=[O:11])=[CH:6][CH:5]=1)=O.COC(OC)[N:16]([CH3:18])C.[NH2:21]N>O.C1(C)C=CC(S(O)(=O)=O)=CC=1>[N+:10]([C:7]1[CH:8]=[CH:9][C:4]([C:2]2[NH:21][N:16]=[CH:18][CH:1]=2)=[CH:5][CH:6]=1)([O-:12])=[O:11]

참가 물질

5

반응물 3

HCID 7487p-NitroacetophenoneHCID 9321HydrazineHCID 78373Dimethylformamide dimethyl acetal

생성물 1

HCID 27370713-(4-Nitrophenyl)-1H-pyrazole수율 58.8%

시약·촉매·용매 1

HCID 521998p-Toluenesulfonic acid monohydrate촉매

실험 절차

4-Nitroacetophenone(15 g) and N,N-dimethylformamide dimethylacetal(54 g) were refluxed for 1 hour. The reaction mixture was cooled, then crystals precipitate were filtered. To a solution of the crystals obtained (13.5 g) in ethanol (150 ml) was added hydrazine (4.52 g) and p-toluene sulfonic acid monohydrate (0.15 g) and the mixture was refluxed for 1 hours. The solvent was evaporated to dryness and the residue was crystallized from ether to obtain thr title compound (10.1 g).

후처리

  1. temperatureThe reaction mixture was cooled
  2. filtrationcrystals precipitate were filtered
  3. customTo a solution of the crystals obtained (13.5 g) in ethanol (150 ml)
  4. temperaturethe mixture was refluxed for 1 hours
  5. customThe solvent was evaporated to dryness
  6. customthe residue was crystallized from ether

출처 및 근거

ORD 기록
ord-743f2d07680d45fe878525b9a98c2a9b
출처 데이터셋
uspto-grants-2002_01
특허 번호
US06342516B1

연결된 노트

불러오는 중…