N-methyl-2-pyrrolidone → 2,3-Difluoro-1-(2,6-difluoro-phenoxy)-4-nitro-benzene

HRID 13334

반응식

HRID 13334 반응식
[F:1][C:2]1[CH:7]=[CH:6][CH:5]=[C:4]([F:8])[C:3]=1[OH:9].CN1CCCC1=O.[F:17][C:18]1[C:23]([F:24])=[C:22](F)[CH:21]=[CH:20][C:19]=1[N+:26]([O-:28])=[O:27]>[Br-].C([N+](CCCC)(CCCC)CCCC)CCC.C(OCC)(=O)C>[F:24][C:23]1[C:18]([F:17])=[C:19]([N+:26]([O-:28])=[O:27])[CH:20]=[CH:21][C:22]=1[O:9][C:3]1[C:2]([F:1])=[CH:7][CH:6]=[CH:5][C:4]=1[F:8]

참가 물질

6

반응물 3

HCID 13387N-methyl-2-pyrrolidoneHCID 698711,2,3-Trifluoro-4-nitrobenzeneHCID 943922,6-Difluorophenol

생성물 1

HCID 231452862,3-Difluoro-1-(2,6-difluoro-phenoxy)-4-nitro-benzene

시약·촉매·용매 2

HCID 74236Tetrabutylammonium Bromide촉매HCID 8857Ethyl Acetate용매

반응 조건

온도
130 °C

실험 절차

470 mg of 2,6-difluoro-phenol and 1.5 g of tetrabutylammonium bromide were added to an N-methylpyrrolidinone (13 ml) solution of 500 mg of 2,3,4-trifluoro-nitrobenzene, and the reaction liquid was stirred overnight at 130° C. The reaction liquid was diluted with ethyl acetate, washed with water and saturated saline in order, and dried with anhydrous sodium sulfate. The solvent was evaporated away under reduced pressure, and the resulting residue was purified through silica gel column chromatography (developing solvent: hexane/ethyl acetate=4/1) to obtain the entitled compound.

후처리

  1. customthe reaction liquid
  2. customThe reaction liquid
  3. washwashed with water and saturated saline in order
  4. dry with materialdried with anhydrous sodium sulfate
  5. customThe solvent was evaporated away under reduced pressure
  6. customthe resulting residue was purified through silica gel column chromatography (developing solvent: hexane/ethyl acetate=4/1)
  7. customto obtain the entitled compound

출처 및 근거

ORD 기록
ord-11f1adab8b8e4535907931e7f083cac5
출처 데이터셋
uspto-grants-2010_06
특허 번호
US07728025B2

연결된 노트

불러오는 중…