1,2-Dichloroethane → 2,5-Dioxopyrrolidin-1-yl 18-((4-(3,5-dioxohexyl)phenyl)amino)-14,18-dioxo-4,7,10-trioxa-13-azaoctadecan-1-oate

HRID 1402664노트

반응식

HRID 1402664 반응식
C([O:5][C:6](=[O:41])[CH2:7][CH2:8][O:9][CH2:10][CH2:11][O:12][CH2:13][CH2:14][O:15][CH2:16][CH2:17][NH:18][C:19](=[O:40])[CH2:20][CH2:21][CH2:22][C:23](=[O:39])[NH:24][C:25]1[CH:30]=[CH:29][C:28]([CH2:31][CH2:32][C:33](=[O:38])[CH2:34][C:35](=[O:37])[CH3:36])=[CH:27][CH:26]=1)(C)(C)C.CCN(C(C)C)C(C)C.O[N:52]1[C:56](=[O:57])[CH2:55][CH2:54][C:53]1=[O:58].C(Cl)CCl>C(O)(C(F)(F)F)=O.C(Cl)Cl.C(Cl)Cl>[O:58]=[C:53]1[CH2:54][CH2:55][C:56](=[O:57])[N:52]1[O:5][C:6](=[O:41])[CH2:7][CH2:8][O:9][CH2:10][CH2:11][O:12][CH2:13][CH2:14][O:15][CH2:16][CH2:17][NH:18][C:19](=[O:40])[CH2:20][CH2:21][CH2:22][C:23](=[O:39])[NH:24][C:25]1[CH:26]=[CH:27][C:28]([CH2:31][CH2:32][C:33](=[O:38])[CH2:34][C:35](=[O:37])[CH3:36])=[CH:29][CH:30]=1

참가 물질

7

반응물 4

HCID 111,2-DichloroethaneHCID 80170N-HydroxysuccinimideHCID 81531DiisopropylethylamineHCID 670685163-{2-[2-(2-{4-[4-(3,5-Dioxo-hexyl)-phenylcarbamoyl]-butyrylamino}-ethoxy)-ethoxy]-ethoxy}-propionic acid tert-butyl ester

생성물 1

HCID 114563222,5-Dioxopyrrolidin-1-yl 18-((4-(3,5-dioxohexyl)phenyl)amino)-14,18-dioxo-4,7,10-trioxa-13-azaoctadecan-1-oate

시약·촉매·용매 2

HCID 6344Dichloromethane용매HCID 21863450Trifluoroacetic acid methylene chloride용매

실험 절차

3-{2-[2-(2-{4-[4-(3,5-Dioxo-hexyl)-phenylcarbamoyl]-butyrylamino}-ethoxy)-ethoxy]-ethoxy}-propionic acid tert-butyl ester (400 mg, 0.692 mmol) was dissolved in TFA/CH2Cl2 (1:1, 3 mL) and the mixture stirred overnight. The solvent was removed to give an oil as the acid intermediate. This oil was dissolved in CH2Cl2 (4 mL) containing DIEA (569 L, 3.09 mmol), N-hydroxysuccinimide (119 mg, 1.03 mmol) and EDC (197 mg, 1.0 mmol) and the mixture stirred over the night. The solvent was removed and the residual oil was purified using column chromatography EtOAc/MeOH (95:5) to give an oil as the title compound, (M+1)=620.

후처리

  1. customThe solvent was removed
  2. customto give an oil as the acid intermediate
  3. stirringthe mixture stirred over the night
  4. customThe solvent was removed
  5. customthe residual oil was purified

출처 및 근거

ORD 기록
ord-66095fd072de4a0ba4ad2f68b3743a11
출처 데이터셋
uspto-grants-2014_12
특허 번호
US08912148B2

반응 노트

불러오는 중…