Trimethylsilylacetylene → Methyl 2-(2-((trimethylsilyl)ethynyl)phenyl)acetate

HRID 1473023

반응식

HRID 1473023 반응식
I[C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][C:3]=1[CH2:8][C:9]([O:11][CH3:12])=[O:10].[CH3:13][Si:14]([C:17]#[CH:18])([CH3:16])[CH3:15]>Cl[Pd](Cl)([P](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1)[P](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1>[CH3:13][Si:14]([C:17]#[C:18][C:2]1[CH:7]=[CH:6][CH:5]=[CH:4][C:3]=1[CH2:8][C:9]([O:11][CH3:12])=[O:10])([CH3:16])[CH3:15]

참가 물질

4

반응물 2

HCID 66111TrimethylsilylacetyleneHCID 640185Methyl 2-(2-iodophenyl)acetate

생성물 1

HCID 59457733Methyl 2-(2-((trimethylsilyl)ethynyl)phenyl)acetate

시약·촉매·용매 1

HCID 178418476HCID 178418476, 화합물촉매

실험 절차

Methyl 2-(2-iodophenyl)acetate (I9) (4.65 g, 16.8 mmol), PdCl2(PPh3)2 (295 mg, 421 μmol) and Cu(I)I (80.0 mg, 421 μmol) were placed into an oven dried reaction flask under nitrogen. (Trimethylsilyl)acetylene (2.80 mL, 20.2 mmol), dry degassed THF (20 mL) and triethylamine (20 mL) were added and the reaction mixture was stirred at room temperature for 16 hours. The volatiles were removed under reduced pressure to give a black residue which was adsorbed onto silica then chromatographed on silica gel (0-5% ethyl acetate/petroleum benzine 40-60° C.) to give the title compound (I10) (4.63 g, 99%) as a light brown liquid; 1H NMR (400 MHz, CDCl3) δ 7.48 (dd, J=7.5, 0.8 Hz, 1H), 7.32-7.14 (m, 3H), 3.84 (s, 2H), 3.71 (s, 3H), 0.26 (s, 9H). LCMS Method C: rt 6.64 min.

후처리

  1. customdried
  2. customreaction flask under nitrogen
  3. customdegassed THF (20 mL) and triethylamine (20 mL)
  4. additionwere added
  5. customThe volatiles were removed under reduced pressure
  6. customto give a black residue which
  7. customthen chromatographed on silica gel (0-5% ethyl acetate/petroleum benzine 40-60° C.)

출처 및 근거

ORD 기록
ord-2dcc2fc004c045128958145b2b8d6029
출처 데이터셋
uspto-grants-2015_04
특허 번호
US09012461B2

연결된 노트

불러오는 중…