1-Ethyl-3-(3'-dimethylaminopropyl)carbodiimide → HCID 67812272, 화합물

HRID 1527645노트

반응식

HRID 1527645 반응식
[CH3:1][NH:2][C:3]1[C:8]([NH2:9])=[CH:7][C:6]([C:10]([F:13])([F:12])[F:11])=[CH:5][N:4]=1.CCN=C=NCCCN(C)C.[Cl:25][C:26]1[C:27]([C:32](O)=[O:33])=[N:28][CH:29]=[N:30][CH:31]=1.C(=O)([O-])O.[Na+]>CN(C)C1C=CN=CC=1.N1C=CC=CC=1.C1COCC1>[Cl:25][C:26]1[C:27]([C:32]([NH:9][C:8]2[C:3]([NH:2][CH3:1])=[N:4][CH:5]=[C:6]([C:10]([F:13])([F:11])[F:12])[CH:7]=2)=[O:33])=[N:28][CH:29]=[N:30][CH:31]=1

참가 물질

8

반응물 4

HCID 159081-Ethyl-3-(3'-dimethylaminopropyl)carbodiimideHCID 516892Sodium BicarbonateHCID 2735930N2-Methyl-5-(trifluoromethyl)pyridine-2,3-diamineHCID 200293965-Chloropyrimidine-4-carboxylic acid

생성물 1

HCID 67812272HCID 67812272, 화합물

시약·촉매·용매 3

HCID 142844-(Dimethylamino)pyridine촉매HCID 1049Pyridine용매HCID 8028Tetrahydrofuran용매

반응 조건

온도
50 °C

실험 절차

To a mixture of N2-methyl-5-trifluoromethylpyridine-2,3-diamine (2.65 g), WSC (2.66 g), 4-dimethylaminopyridine (0.10 g), THF (10 ml), and pyridine (10 ml), 5-chloropyrimidine-4-carboxylic acid was added under ice-cooling, and the reaction mixture was stirred at 50° C. for 8 hours. After standing to cool the reaction mixture to room temperature, to the reaction mixture, saturated aqueous sodium hydrogen carbonate solution was added, and extracted with ethyl acetate. The organic layer was dried over sodium sulfate, and concentrated under reduced pressure. The residue was subjected to silica gel column chromatography to give 1.77 g of 5-chloro-N-(2-methylamino-5-trifluoromethyl-pyridin-3-yl)-pyrimidine-4-carboxamide.

후처리

  1. additionwas added under ice-
  2. temperaturecooling
  3. temperatureto cool the reaction mixture to room temperature
  4. extractionextracted with ethyl acetate
  5. dry with materialThe organic layer was dried over sodium sulfate
  6. concentrationconcentrated under reduced pressure

출처 및 근거

ORD 기록
ord-39b89df4634f45a0b29e8ffcfe96b84b
출처 데이터셋
uspto-grants-2015_07
특허 번호
US09089136B2

반응 노트

불러오는 중…