3-Chloro-4-methylphenyl isocyanate → 4-Bromomethyl-3-chlorophenylisocyanate

HRID 1583483노트

반응식

HRID 1583483 반응식
[Cl:1][C:2]1[CH:3]=[C:4]([N:9]=[C:10]=[O:11])[CH:5]=[CH:6][C:7]=1[CH3:8].[Br:12]N1C(=O)CCC1=O>C(Cl)(Cl)(Cl)Cl.C(OOC(=O)C1C=CC=CC=1)(=O)C1C=CC=CC=1>[Br:12][CH2:8][C:7]1[CH:6]=[CH:5][C:4]([N:9]=[C:10]=[O:11])=[CH:3][C:2]=1[Cl:1]

참가 물질

5

반응물 2

HCID 628323-Chloro-4-methylphenyl isocyanateHCID 67184N-bromobutanimide

생성물 1

HCID 135572724-Bromomethyl-3-chlorophenylisocyanate수율 100%

시약·촉매·용매 2

HCID 7187Benzoyl Peroxide촉매HCID 5943Carbon Tetrachloride용매

실험 절차

To a stirred solution of 100.0 grams (0.597 mole) of 3-chloro-4-methylphenylisocyanate in 1000 ml of carbon tetrachloride, under an argon atmosphere were added 116.8 grams (0.656 mole) of N-bromosuccinimide and 5.0 grams (0.021 mole) of benzoyl peroxide. The reaction mixture was warmed to reflux where it stirred for 4 hours; then it was allowed to cool to ambient temperature as it stood for 16 hours. The mixture was filtered and the filtrate concentrated under reduced pressure to give 147.1 grams of 4-bromomethyl-3-chlorophenylisocyanate as a residual oil. The oil was used without further purification.

후처리

  1. temperatureThe reaction mixture was warmed
  2. temperatureto reflux where it
  3. waitstood for 16 hours
  4. filtrationThe mixture was filtered
  5. concentrationthe filtrate concentrated under reduced pressure

출처 및 근거

ORD 기록
ord-57883c279b6642189f7f2c9595aa8581
출처 데이터셋
uspto-grants-1985_11
특허 번호
US04552585

반응 노트

불러오는 중…