Water → HCID 13535661, 화합물

HRID 1583590노트

반응식

HRID 1583590 반응식
[F:1][CH2:2][CH2:3][O:4][C:5]1[CH:12]=[CH:11][C:8]([CH2:9]Cl)=[CH:7][CH:6]=1.[Cl:13][C:14]1[CH:25]=[CH:24][C:17]([O:18][C:19]([CH3:23])([CH3:22])[CH2:20][OH:21])=[CH:16][CH:15]=1.[OH-].[Na+].O>[Br-].C([N+](CC)(CC)CC1C=CC=CC=1)C.C1(C)C=CC=CC=1>[Cl:13][C:14]1[CH:25]=[CH:24][C:17]([O:18][C:19]([CH3:22])([CH3:23])[CH2:20][O:21][CH2:9][C:8]2[CH:11]=[CH:12][C:5]([O:4][CH2:3][CH2:2][F:1])=[CH:6][CH:7]=2)=[CH:16][CH:15]=1

참가 물질

7

반응물 4

HCID 962WaterHCID 14798Sodium HydroxideHCID 191086602-(4-Chlorophenoxy)-2-methylpropan-1-olHCID 202592671-(Chloromethyl)-4-(2-fluoroethoxy)benzene

생성물 1

HCID 13535661HCID 13535661, 화합물수율 91%

시약·촉매·용매 2

HCID 165294Benzyltriethylammonium bromide촉매HCID 1140Toluene용매

반응 조건

온도
50 °C

실험 절차

A mixture consisting of 1.0 g of 4-(2-fluoroethoxy)benzyl chloride, 1.0 g of 2-(4-chlorophenoxy)-2-methylpropyl alcohol, 0.3 g of triethylbenzylammonium bromide and 20 g of a 50% aqueous solution of sodium hydroxide was stirred at 50° C. for 2 hours. The reaction mixture was cooled to room temperature, and poured into water. Toluene was added, and the mixture was fully stirred. The toluene layer was separated, washed with water, and dried over anhydrous sodium sulfate. Toluene and low-volatile components were evaporated under reduced pressure to give 1.6 g of the desired 4-(2-fluoroethoxy)benzyl 2-(4-chlorophenoxy)-2-methylpropyl ether.

후처리

  1. temperatureThe reaction mixture was cooled to room temperature
  2. stirringthe mixture was fully stirred
  3. customThe toluene layer was separated
  4. washwashed with water
  5. dry with materialdried over anhydrous sodium sulfate
  6. customToluene and low-volatile components were evaporated under reduced pressure

출처 및 근거

ORD 기록
ord-9eefc2268fd841b5bb7506413bc17f9e
출처 데이터셋
uspto-grants-1985_11
특허 번호
US04552894

반응 노트

불러오는 중…